4,6,12,18-Tetrahydroxy-21-methyl-10-methylidene-22-(3-methylnona-1,3,5,8-tetraenyl)-1-oxacyclodocosa-7,15,19-trien-2-one
| Internal ID | 67fda42f-114c-43d8-8d08-9e838b85cfd7 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | 4,6,12,18-tetrahydroxy-21-methyl-10-methylidene-22-(3-methylnona-1,3,5,8-tetraenyl)-1-oxacyclodocosa-7,15,19-trien-2-one |
| SMILES (Canonical) | CC1C=CC(CC=CCCC(CC(=C)CC=CC(CC(CC(=O)OC1C=CC(=CC=CCC=C)C)O)O)O)O |
| SMILES (Isomeric) | CC1C=CC(CC=CCCC(CC(=C)CC=CC(CC(CC(=O)OC1C=CC(=CC=CCC=C)C)O)O)O)O |
| InChI | InChI=1S/C33H48O6/c1-5-6-7-9-13-25(2)18-21-32-27(4)19-20-28(34)15-10-8-11-16-29(35)22-26(3)14-12-17-30(36)23-31(37)24-33(38)39-32/h5,7-10,12-13,17-21,27-32,34-37H,1,3,6,11,14-16,22-24H2,2,4H3 |
| InChI Key | GXWAJHCYRDABLE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C33H48O6 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.34508925 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | 5.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.42% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.77% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.14% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.12% | 89.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.05% | 96.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 90.75% | 89.34% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.87% | 97.21% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.84% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.64% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.38% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.76% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.99% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.87% | 99.23% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 80.72% | 97.63% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.60% | 90.71% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 80.20% | 97.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85066364 |
| LOTUS | LTS0230090 |
| wikiData | Q104167583 |