(1R,1'S,3S,4'R,5S,5'R,6S)-4'-bromo-5'-chloro-4,4,5',6-tetramethylspiro[7-oxabicyclo[4.1.0]heptane-5,2'-cyclohexane]-1',3-diol
| Internal ID | 665cf019-f373-4f15-8997-f58485bee842 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Chamigranes |
| IUPAC Name | (1R,1'S,3S,4'R,5S,5'R,6S)-4'-bromo-5'-chloro-4,4,5',6-tetramethylspiro[7-oxabicyclo[4.1.0]heptane-5,2'-cyclohexane]-1',3-diol |
| SMILES (Canonical) | CC1(C(CC2C(C13CC(C(CC3O)(C)Cl)Br)(O2)C)O)C |
| SMILES (Isomeric) | C[C@]1(C[C@@H]([C@@]2(C[C@H]1Br)[C@]3([C@H](O3)C[C@@H](C2(C)C)O)C)O)Cl |
| InChI | InChI=1S/C15H24BrClO3/c1-12(2)9(18)5-11-14(4,20-11)15(12)6-8(16)13(3,17)7-10(15)19/h8-11,18-19H,5-7H2,1-4H3/t8-,9+,10+,11-,13-,14-,15-/m1/s1 |
| InChI Key | FDSHBAAWEKXEPR-FGMSCQTESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24BrClO3 |
| Molecular Weight | 367.70 g/mol |
| Exact Mass | 366.05973 g/mol |
| Topological Polar Surface Area (TPSA) | 53.00 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
![2D Structure of (1R,1'S,3S,4'R,5S,5'R,6S)-4'-bromo-5'-chloro-4,4,5',6-tetramethylspiro[7-oxabicyclo[4.1.0]heptane-5,2'-cyclohexane]-1',3-diol](https://plantaedb.com/storage/docs/compounds/2023/11/000f52f0-8459-11ee-9efe-5d8ee86ce6fb.jpg "2D Structure of (1R,1'S,3S,4'R,5S,5'R,6S)-4'-bromo-5'-chloro-4,4,5',6-tetramethylspiro[7-oxabicyclo[4.1.0]heptane-5,2'-cyclohexane]-1',3-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.39% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.53% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.01% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.88% | 97.25% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.68% | 96.77% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 89.31% | 85.11% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 88.13% | 95.27% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.18% | 96.61% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.57% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.26% | 85.14% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.89% | 91.24% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.60% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.26% | 92.94% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.78% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.07% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162972738 |
| LOTUS | LTS0059784 |
| wikiData | Q104993762 |