(-)-Wilsonirine
Internal ID | 44341e77-230e-4115-a60b-92432c0564b0 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | (6aR)-2,9,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
SMILES (Canonical) | COC1=C(C2=C3C(CC4=CC(=C(C=C42)OC)OC)NCCC3=C1)O |
SMILES (Isomeric) | COC1=C(C2=C3[C@@H](CC4=CC(=C(C=C42)OC)OC)NCCC3=C1)O |
InChI | InChI=1S/C19H21NO4/c1-22-14-8-11-6-13-17-10(4-5-20-13)7-16(24-3)19(21)18(17)12(11)9-15(14)23-2/h7-9,13,20-21H,4-6H2,1-3H3/t13-/m1/s1 |
InChI Key | MDUPNPFWUYFJQG-CYBMUJFWSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H21NO4 |
Molecular Weight | 327.40 g/mol |
Exact Mass | 327.14705815 g/mol |
Topological Polar Surface Area (TPSA) | 60.00 Ų |
XlogP | 2.60 |
CHEMBL2332234 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.87% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.31% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 96.23% | 92.94% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.70% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.68% | 97.09% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 92.00% | 91.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.37% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.84% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.47% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 89.40% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.27% | 90.00% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.46% | 88.48% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.41% | 93.99% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.96% | 95.56% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 86.50% | 95.62% |
CHEMBL2535 | P11166 | Glucose transporter | 85.87% | 98.75% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.27% | 99.17% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 84.51% | 91.00% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 84.05% | 92.68% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.52% | 92.62% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.95% | 91.03% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.63% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.26% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Corydalis paniculigera |
PubChem | 71716361 |
LOTUS | LTS0213389 |
wikiData | Q105161966 |