(-)-Verapamil
Internal ID | 5fd898e9-ece3-4c86-af68-bd1f9a531576 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenylbutylamines |
IUPAC Name | (2S)-2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentanenitrile |
SMILES (Canonical) | CC(C)C(CCCN(C)CCC1=CC(=C(C=C1)OC)OC)(C#N)C2=CC(=C(C=C2)OC)OC |
SMILES (Isomeric) | CC(C)[C@](CCCN(C)CCC1=CC(=C(C=C1)OC)OC)(C#N)C2=CC(=C(C=C2)OC)OC |
InChI | InChI=1S/C27H38N2O4/c1-20(2)27(19-28,22-10-12-24(31-5)26(18-22)33-7)14-8-15-29(3)16-13-21-9-11-23(30-4)25(17-21)32-6/h9-12,17-18,20H,8,13-16H2,1-7H3/t27-/m0/s1 |
InChI Key | SGTNSNPWRIOYBX-MHZLTWQESA-N |
Popularity | 194 references in papers |
Molecular Formula | C27H38N2O4 |
Molecular Weight | 454.60 g/mol |
Exact Mass | 454.28315770 g/mol |
Topological Polar Surface Area (TPSA) | 64.00 Ų |
XlogP | 3.80 |
Atomic LogP (AlogP) | 5.09 |
H-Bond Acceptor | 6 |
H-Bond Donor | 0 |
Rotatable Bonds | 13 |
36622-29-4 |
(S)-VERAPAMIL |
(S)-(-)-verapamil |
(S) Verapamil |
(-)-(S)-verapamil |
CHEMBL36148 |
(-)-3-(3,4-dimethoxyphenyl)-6-[(5,6-dimethoxyphenethyl)methylamino]hexane-3-carbonitrile |
CHEBI:77736 |
(S)-5-((3,4-dimethoxyphenethyl)(methyl)amino)-2-(3,4-dimethoxyphenyl)-2-isopropylpentanenitrile |
9P7619E627 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9735 | 97.35% |
Caco-2 | + | 0.5463 | 54.63% |
Blood Brain Barrier | - | 0.7500 | 75.00% |
Human oral bioavailability | + | 0.6143 | 61.43% |
Subcellular localzation | Mitochondria | 0.5532 | 55.32% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | - | 0.7532 | 75.32% |
OATP1B3 inhibitior | + | 0.9430 | 94.30% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | + | 0.6500 | 65.00% |
BSEP inhibitior | + | 0.9390 | 93.90% |
P-glycoprotein inhibitior | + | 0.9674 | 96.74% |
P-glycoprotein substrate | + | 0.9291 | 92.91% |
CYP3A4 substrate | + | 0.7963 | 79.63% |
CYP2C9 substrate | - | 0.5000 | 50.00% |
CYP2D6 substrate | + | 0.6427 | 64.27% |
CYP3A4 inhibition | + | 0.7960 | 79.60% |
CYP2C9 inhibition | - | 0.9071 | 90.71% |
CYP2C19 inhibition | - | 0.9026 | 90.26% |
CYP2D6 inhibition | - | 0.9231 | 92.31% |
CYP1A2 inhibition | - | 0.9553 | 95.53% |
CYP2C8 inhibition | + | 0.6246 | 62.46% |
CYP inhibitory promiscuity | - | 0.9181 | 91.81% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.7623 | 76.23% |
Carcinogenicity (trinary) | Non-required | 0.6565 | 65.65% |
Eye corrosion | - | 0.9886 | 98.86% |
Eye irritation | - | 0.9582 | 95.82% |
Skin irritation | - | 0.7995 | 79.95% |
Skin corrosion | - | 0.9399 | 93.99% |
Ames mutagenesis | - | 0.7100 | 71.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.9552 | 95.52% |
Micronuclear | - | 0.6800 | 68.00% |
Hepatotoxicity | + | 0.7500 | 75.00% |
skin sensitisation | - | 0.8775 | 87.75% |
Respiratory toxicity | + | 0.9000 | 90.00% |
Reproductive toxicity | + | 0.6111 | 61.11% |
Mitochondrial toxicity | + | 0.9125 | 91.25% |
Nephrotoxicity | - | 0.8450 | 84.50% |
Acute Oral Toxicity (c) | II | 0.7343 | 73.43% |
Estrogen receptor binding | + | 0.7477 | 74.77% |
Androgen receptor binding | + | 0.8697 | 86.97% |
Thyroid receptor binding | + | 0.7590 | 75.90% |
Glucocorticoid receptor binding | - | 0.8183 | 81.83% |
Aromatase binding | + | 0.7197 | 71.97% |
PPAR gamma | - | 0.5000 | 50.00% |
Honey bee toxicity | - | 0.6206 | 62.06% |
Biodegradation | - | 0.8250 | 82.50% |
Crustacea aquatic toxicity | + | 0.6400 | 64.00% |
Fish aquatic toxicity | + | 0.9798 | 97.98% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
15848.93 nM 19952.62 nM |
AC50 AC50 |
via CMAUP
via CMAUP |
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
12.6 nM |
Potency |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
2511.9 nM 2511.9 nM 2511.9 nM 2511.9 nM |
Potency Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP via CMAUP |
CHEMBL240 | Q12809 | HERG |
10 nM |
IC50 |
via Super-PRED
|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
15848.9 nM |
Potency |
via CMAUP
|
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 |
35 nM 113 nM |
Kd Kd |
via Super-PRED
via Super-PRED |
CHEMBL4302 | P08183 | P-glycoprotein 1 |
2090 nM 2440 nM |
IC50 IC50 |
PMID: 12477351
PMID: 12569305 |
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
12589.3 nM 12589.3 nM 25118.9 nM 7943.3 nM 7943.3 nM |
Potency Potency Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP via CMAUP via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.63% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 98.29% | 98.95% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 96.11% | 85.31% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.22% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 93.86% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.29% | 86.33% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 88.93% | 92.68% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 88.85% | 93.18% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 88.80% | 87.16% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 88.79% | 90.20% |
CHEMBL3837 | P07711 | Cathepsin L | 88.51% | 96.61% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.25% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.20% | 95.89% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.07% | 93.65% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.76% | 96.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.79% | 93.31% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.64% | 96.25% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.52% | 93.99% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.49% | 89.62% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.34% | 90.71% |
CHEMBL5747 | Q92793 | CREB-binding protein | 82.63% | 95.12% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.42% | 100.00% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 81.03% | 96.86% |
CHEMBL249 | P25103 | Neurokinin 1 receptor | 80.58% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.49% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper nigrum |
PubChem | 92305 |
NPASS | NPC231884 |
ChEMBL | CHEMBL36148 |