(+-)-Teframidine
| Internal ID | 837e3162-4cdb-4f0d-855e-ef31e4a01df0 |
| Taxonomy | Benzenoids > Dibenzocycloheptenes |
| IUPAC Name | 23-methyl-5,7,16,18-tetraoxa-23-azahexacyclo[10.9.2.02,10.04,8.013,21.015,19]tricosa-2,4(8),9,13,15(19),20-hexaene |
| SMILES (Canonical) | CN1CC2C3=CC4=C(C=C3CC1C5=CC6=C(C=C25)OCO6)OCO4 |
| SMILES (Isomeric) | CN1CC2C3=CC4=C(C=C3CC1C5=CC6=C(C=C25)OCO6)OCO4 |
| InChI | InChI=1S/C19H17NO4/c1-20-7-14-11-4-17-16(21-8-22-17)3-10(11)2-15(20)13-6-19-18(5-12(13)14)23-9-24-19/h3-6,14-15H,2,7-9H2,1H3 |
| InChI Key | VCIZOTXPSIGTKG-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11575802 g/mol |
| Topological Polar Surface Area (TPSA) | 40.20 Ų |
| XlogP | 2.90 |
| NSC383454 |
| NSC-383454 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 97.02% | 93.40% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.69% | 96.77% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.50% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.48% | 98.95% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 86.92% | 86.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.41% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.00% | 91.11% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 83.48% | 80.96% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.32% | 89.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.14% | 89.62% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.79% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.58% | 85.14% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 80.40% | 95.62% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.40% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Roemeria refracta |
| PubChem | 436140 |
| LOTUS | LTS0111625 |
| wikiData | Q104383527 |