(-)-streptophenazine O
| Internal ID | 2e99ebc1-3960-4ea0-9ff6-d003a99a1b37 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines > Phenazines and derivatives |
| IUPAC Name | (2R)-2-[(S)-hydroxy-(6-methoxycarbonylphenazin-1-yl)methyl]nonanoic acid |
| SMILES (Canonical) | CCCCCCCC(C(C1=C2C(=CC=C1)N=C3C(=N2)C=CC=C3C(=O)OC)O)C(=O)O |
| SMILES (Isomeric) | CCCCCCC[C@H]([C@@H](C1=C2C(=CC=C1)N=C3C(=N2)C=CC=C3C(=O)OC)O)C(=O)O |
| InChI | InChI=1S/C24H28N2O5/c1-3-4-5-6-7-10-17(23(28)29)22(27)15-11-8-13-18-20(15)25-19-14-9-12-16(21(19)26-18)24(30)31-2/h8-9,11-14,17,22,27H,3-7,10H2,1-2H3,(H,28,29)/t17-,22-/m1/s1 |
| InChI Key | XYORNYZVPHCJQE-VGOFRKELSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19982200 g/mol |
| Topological Polar Surface Area (TPSA) | 110.00 Ų |
| XlogP | 4.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.03% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.08% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.63% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.31% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.10% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.86% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.30% | 90.17% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.73% | 92.08% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.92% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.13% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.19% | 95.50% |
| CHEMBL3891 | P07384 | Calpain 1 | 88.62% | 93.04% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 85.97% | 93.31% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.85% | 89.63% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.70% | 100.00% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 82.83% | 81.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.60% | 98.75% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.46% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139591601 |
| LOTUS | LTS0068267 |
| wikiData | Q105344592 |