(-)-Slaframine
| Internal ID | 2899a934-99c5-45a8-8ade-396d232fbb19 |
| Taxonomy | Organoheterocyclic compounds > Indolizidines |
| IUPAC Name | [(1S,6S)-6-amino-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate |
| SMILES (Canonical) | CC(=O)OC1CCN2C1CCC(C2)N |
| SMILES (Isomeric) | CC(=O)O[C@H]1CCN2C1CC[C@@H](C2)N |
| InChI | InChI=1S/C10H18N2O2/c1-7(13)14-10-4-5-12-6-8(11)2-3-9(10)12/h8-10H,2-6,11H2,1H3/t8-,9?,10-/m0/s1 |
| InChI Key | YYIUHLPAZILPSG-SMILAEQMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.136827821 g/mol |
| Topological Polar Surface Area (TPSA) | 55.60 Ų |
| XlogP | 0.00 |
| C06185 |
| CHEBI:9173 |
| (1S,6S)-6-aminooctahydroindolizin-1-yl acetate |
| [(1S,6S)-6-amino-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.03% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.58% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.80% | 91.19% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 89.10% | 95.69% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.83% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.40% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.71% | 95.89% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.02% | 93.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.10% | 94.33% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.05% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.03% | 92.94% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 80.84% | 98.77% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.51% | 97.25% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.46% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia xipshuanbannaensis |
| PubChem | 49787007 |
| LOTUS | LTS0183069 |
| wikiData | Q105009914 |