(-)-sanguinolignan B
Internal ID | 2612df42-cf53-4869-81d7-c1b922516abe |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans > Tetrahydrofuran lignans > 9,9-epoxylignans > Dibenzylbutyrolactone lignans |
IUPAC Name | (3S,4S)-3-(1,3-benzodioxole-5-carbonyl)-4-[(S)-1,3-benzodioxol-5-yl(hydroxy)methyl]oxolan-2-one |
SMILES (Canonical) | C1C(C(C(=O)O1)C(=O)C2=CC3=C(C=C2)OCO3)C(C4=CC5=C(C=C4)OCO5)O |
SMILES (Isomeric) | C1[C@H]([C@H](C(=O)O1)C(=O)C2=CC3=C(C=C2)OCO3)[C@@H](C4=CC5=C(C=C4)OCO5)O |
InChI | InChI=1S/C20H16O8/c21-18(10-1-3-13-15(5-10)27-8-25-13)12-7-24-20(23)17(12)19(22)11-2-4-14-16(6-11)28-9-26-14/h1-6,12,17-18,21H,7-9H2/t12-,17+,18-/m1/s1 |
InChI Key | VFLHIZSORMIUMV-OCBCSQNSSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H16O8 |
Molecular Weight | 384.30 g/mol |
Exact Mass | 384.08451746 g/mol |
Topological Polar Surface Area (TPSA) | 101.00 Ų |
XlogP | 2.20 |
CHEBI:70486 |
Sanguinolignan B |
CHEMBL1641900 |
Q27138821 |
(-)-(8S,7'S,8'S)-3,3',4,4'-bis(methylenedioxy)-7'-hydroxy-7-oxolignano-9,9'-lactone |
(3S,4S)-3-(2H-1,3-benzodioxole-5-carbonyl)-4-[(S)-(2H-1,3-benzodioxol-5-yl)(hydroxy)methyl]oxolan-2-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 98.70% | 94.80% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.56% | 91.11% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.01% | 96.77% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.66% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 91.99% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.36% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.49% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.14% | 90.00% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 87.33% | 80.96% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.18% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.09% | 91.19% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.78% | 93.40% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.53% | 92.62% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.44% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.42% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.87% | 95.56% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.58% | 90.24% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.02% | 98.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.34% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper obliquum |
PubChem | 50899863 |
LOTUS | LTS0056992 |
wikiData | Q27138821 |