(+)-Pisiferol
| Internal ID | 1c5506ab-d0fa-43cc-8283-7afde61646ca |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 4b-(hydroxymethyl)-8,8-dimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol |
| SMILES (Canonical) | CC(C)C1=C(C=C2C(=C1)CCC3C2(CCCC3(C)C)CO)O |
| SMILES (Isomeric) | CC(C)C1=C(C=C2C(=C1)CCC3C2(CCCC3(C)C)CO)O |
| InChI | InChI=1S/C20H30O2/c1-13(2)15-10-14-6-7-18-19(3,4)8-5-9-20(18,12-21)16(14)11-17(15)22/h10-11,13,18,21-22H,5-9,12H2,1-4H3 |
| InChI Key | NKGGFTFDYGTUSL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.224580195 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 5.30 |
| NKGGFTFDYGTUSL-UHFFFAOYSA-N |
| Podocarpa-8,11,13-triene-12,17-diol, 13-isopropyl- |
| 4a(2H)-Phenanthrenemethanol, 1,3,4,9,10,10a-hexahydro-6-hydroxy-1,1-dimethyl-7-(1-methylethyl)-, (4aR,10aS)- |
| 4a(2H)-Phenanthrenemethanol, 1,3,4,9,10,10a-hexahydro-6-hydroxy-1,1-dimethyl-7-(1-methylethyl)-, (4aR-trans)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.21% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.09% | 93.99% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.67% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.48% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.27% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.25% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.77% | 94.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.17% | 90.71% |
| CHEMBL233 | P35372 | Mu opioid receptor | 89.82% | 97.93% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.19% | 99.15% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.98% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.66% | 100.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.19% | 93.40% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.57% | 97.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 86.33% | 91.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.93% | 95.56% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.84% | 99.18% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.19% | 98.10% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.57% | 82.69% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.56% | 96.38% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.45% | 93.04% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.58% | 95.50% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.30% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Chamaecyparis formosensis |
| Chamaecyparis lawsoniana |
| Chamaecyparis pisifera |
| Sequoia sempervirens |
| PubChem | 13785024 |
| LOTUS | LTS0203539 |
| wikiData | Q105180568 |