(+)-Isofebrifugine
Internal ID | 7c28270c-7eb5-4b56-99b4-6ecf22eeaf1f |
Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinazolines |
IUPAC Name | 3-[3-[(2S,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one |
SMILES (Canonical) | C1CC(C(NC1)CC(=O)CN2C=NC3=CC=CC=C3C2=O)O |
SMILES (Isomeric) | C1C[C@@H]([C@@H](NC1)CC(=O)CN2C=NC3=CC=CC=C3C2=O)O |
InChI | InChI=1S/C16H19N3O3/c20-11(8-14-15(21)6-3-7-17-14)9-19-10-18-13-5-2-1-4-12(13)16(19)22/h1-2,4-5,10,14-15,17,21H,3,6-9H2/t14-,15-/m0/s1 |
InChI Key | FWVHWDSCPKXMDB-GJZGRUSLSA-N |
Popularity | 56 references in papers |
Molecular Formula | C16H19N3O3 |
Molecular Weight | 301.34 g/mol |
Exact Mass | 301.14264148 g/mol |
Topological Polar Surface Area (TPSA) | 82.00 Ų |
XlogP | 0.10 |
(+)-Isofebrifugine |
24159-07-7 |
CHEMBL3348937 |
AKOS037514569 |
NCGC00273480-01 |
3-[3-[(2S,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.87% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.67% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.60% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.13% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.77% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.57% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.68% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.40% | 91.11% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 86.50% | 97.64% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.81% | 90.08% |
CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 84.52% | 87.50% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 83.23% | 91.43% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.35% | 86.33% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 81.96% | 92.67% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.57% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asarum caulescens |
Cedrela odorata |
Cipadessa baccifera |
Hydrangea febrifuga |
Hydrangea macrophylla |
PubChem | 11208839 |
LOTUS | LTS0226994 |
wikiData | Q105031658 |