(-)-Herdmanine L
| Internal ID | 4cd356e9-6fe9-4093-92b1-e115d435562d |
| Taxonomy | Phenylpropanoids and polyketides > Depsides and depsidones |
| IUPAC Name | (2S)-2-amino-3-[4-(4-hydroxybenzoyl)oxyphenyl]propanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H15NO5/c17-14(15(19)20)9-10-1-7-13(8-2-10)22-16(21)11-3-5-12(18)6-4-11/h1-8,14,18H,9,17H2,(H,19,20)/t14-/m0/s1 |
| InChI Key | YVYXQUTZASIIIA-AWEZNQCLSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.09502258 g/mol |
| Topological Polar Surface Area (TPSA) | 110.00 Ų |
| XlogP | -0.80 |
| (2S)-2-amino-3-[4-(4-hydroxybenzoyl)oxyphenyl]propanoic acid |
| (-)-Herdmanine L |
| RefChem:67851 |
| CHEMBL2208194 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.58% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.85% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.82% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 93.08% | 90.20% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 91.62% | 94.97% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.68% | 97.21% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.52% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.37% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.82% | 90.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.19% | 95.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.17% | 96.95% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 85.97% | 94.00% |
| CHEMBL209 | P07477 | Trypsin I | 85.62% | 90.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 85.57% | 92.29% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.42% | 90.24% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.89% | 91.71% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.73% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.51% | 95.89% |
| CHEMBL3891 | P07384 | Calpain 1 | 81.41% | 93.04% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.96% | 100.00% |
| CHEMBL3232685 | O00257 | E3 SUMO-protein ligase CBX4 | 80.82% | 93.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.17% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71457892 |
| LOTUS | LTS0191054 |
| wikiData | Q105366314 |