(+)-Erysotramidine
| Internal ID | 2f849b8f-6dc2-4582-ba06-505912f9580b |
| Taxonomy | Alkaloids and derivatives > Erythrina alkaloids > Erythrinanes |
| IUPAC Name | 2,11,12-trimethoxy-1,2,8,9-tetrahydroindolo[7a,1-a]isoquinolin-6-one |
| SMILES (Canonical) | COC1CC23C(=CC(=O)N2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| SMILES (Isomeric) | COC1CC23C(=CC(=O)N2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| InChI | InChI=1S/C19H21NO4/c1-22-14-5-4-13-9-18(21)20-7-6-12-8-16(23-2)17(24-3)10-15(12)19(13,20)11-14/h4-5,8-10,14H,6-7,11H2,1-3H3 |
| InChI Key | AUDDBHVKKYSXKU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 48.00 Ų |
| XlogP | 1.50 |
| 2,11,12-Trimethoxy-1,2,8,9-tetrahydroindolo[7a,1-a]isoquinolin-6-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.03% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.89% | 85.14% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 95.75% | 92.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.14% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.86% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.33% | 86.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.43% | 97.14% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 86.89% | 95.62% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.79% | 93.40% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 84.44% | 92.38% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.13% | 82.38% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.92% | 93.99% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.01% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.64% | 98.95% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 82.05% | 95.53% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.97% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.79% | 91.11% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.72% | 91.07% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.23% | 91.03% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 80.77% | 96.86% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.74% | 94.78% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.14% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina latissima |
| Erythrina lysistemon |
| PubChem | 14589898 |
| LOTUS | LTS0057423 |
| wikiData | Q104918856 |