(+)-Carnegine
Internal ID | 2fece253-a65b-468a-9bce-dbfa6ce9a647 |
Taxonomy | Organoheterocyclic compounds > Tetrahydroisoquinolines |
IUPAC Name | (1R)-6,7-dimethoxy-1,2-dimethyl-3,4-dihydro-1H-isoquinoline |
SMILES (Canonical) | CC1C2=CC(=C(C=C2CCN1C)OC)OC |
SMILES (Isomeric) | C[C@@H]1C2=CC(=C(C=C2CCN1C)OC)OC |
InChI | InChI=1S/C13H19NO2/c1-9-11-8-13(16-4)12(15-3)7-10(11)5-6-14(9)2/h7-9H,5-6H2,1-4H3/t9-/m1/s1 |
InChI Key | HRSIPKSSEVRSPG-SECBINFHSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C13H19NO2 |
Molecular Weight | 221.29 g/mol |
Exact Mass | 221.141578849 g/mol |
Topological Polar Surface Area (TPSA) | 21.70 Ų |
XlogP | 2.10 |
Carnegine, (+)- |
51745-28-9 |
(R)-(+)-Carnegine |
8ODU99Y4XK |
(R)-6,7-Dimethoxy-1,2-dimethyl-1,2,3,4-tetrahydroisoquinoline |
Isoquinoline, 1,2,3,4-tetrahydro-6,7-dimethoxy-1,2-dimethyl-, (1R)- |
UNII-8ODU99Y4XK |
CARNEGINE, (R)- |
CHEMBL1192717 |
DTXSID00199680 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.33% | 96.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.65% | 93.40% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.95% | 92.94% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.75% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.71% | 97.25% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 89.51% | 91.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.66% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.78% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.21% | 86.33% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 86.00% | 100.00% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.50% | 91.03% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 84.98% | 96.86% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 84.58% | 97.31% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.52% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 83.74% | 98.95% |
CHEMBL5747 | Q92793 | CREB-binding protein | 83.08% | 95.12% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.27% | 89.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.19% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.08% | 95.89% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.64% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carnegiea gigantea |
Echium humile subsp. pycnanthum |
Nandina domestica |
PubChem | 821487 |
LOTUS | LTS0199478 |
wikiData | Q27270818 |