(-)-Bicuculline
Internal ID | f18b5804-2043-4e71-9fab-c07c2bf4a7b8 |
Taxonomy | Alkaloids and derivatives > Phthalide isoquinolines |
IUPAC Name | (6S)-6-[(5R)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[3,4-g][1,3]benzodioxol-8-one |
SMILES (Canonical) | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
SMILES (Isomeric) | CN1CCC2=CC3=C(C=C2[C@@H]1[C@@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
InChI | InChI=1S/C20H17NO6/c1-21-5-4-10-6-14-15(25-8-24-14)7-12(10)17(21)18-11-2-3-13-19(26-9-23-13)16(11)20(22)27-18/h2-3,6-7,17-18H,4-5,8-9H2,1H3/t17-,18+/m1/s1 |
InChI Key | IYGYMKDQCDOMRE-MSOLQXFVSA-N |
Popularity | 41 references in papers |
Molecular Formula | C20H17NO6 |
Molecular Weight | 367.40 g/mol |
Exact Mass | 367.10558726 g/mol |
Topological Polar Surface Area (TPSA) | 66.50 Ų |
XlogP | 2.60 |
Atomic LogP (AlogP) | 2.58 |
H-Bond Acceptor | 7 |
H-Bond Donor | 0 |
Rotatable Bonds | 1 |
dl-Bicuculline |
19730-80-4 |
(+-)-Bicuculline |
(6S)-6-[(5R)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[3,4-g][1,3]benzodioxol-8-one |
56083-00-2 |
CHEMBL1316579 |
SCHEMBL16320040 |
TNP00219 |
TNP00335 |
NCGC00017296-01 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9731 | 97.31% |
Caco-2 | + | 0.7738 | 77.38% |
Blood Brain Barrier | + | 0.7000 | 70.00% |
Human oral bioavailability | - | 0.6143 | 61.43% |
Subcellular localzation | Lysosomes | 0.4400 | 44.00% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9247 | 92.47% |
OATP1B3 inhibitior | + | 0.9533 | 95.33% |
MATE1 inhibitior | - | 0.9409 | 94.09% |
OCT2 inhibitior | - | 0.8000 | 80.00% |
BSEP inhibitior | + | 0.8511 | 85.11% |
P-glycoprotein inhibitior | - | 0.6282 | 62.82% |
P-glycoprotein substrate | - | 0.8209 | 82.09% |
CYP3A4 substrate | + | 0.6019 | 60.19% |
CYP2C9 substrate | + | 0.8024 | 80.24% |
CYP2D6 substrate | - | 0.6799 | 67.99% |
CYP3A4 inhibition | + | 0.7959 | 79.59% |
CYP2C9 inhibition | + | 0.7664 | 76.64% |
CYP2C19 inhibition | + | 0.8993 | 89.93% |
CYP2D6 inhibition | - | 0.6229 | 62.29% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | - | 0.9319 | 93.19% |
CYP inhibitory promiscuity | - | 0.5366 | 53.66% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.5613 | 56.13% |
Eye corrosion | - | 0.9881 | 98.81% |
Eye irritation | - | 0.9577 | 95.77% |
Skin irritation | - | 0.7658 | 76.58% |
Skin corrosion | - | 0.9309 | 93.09% |
Ames mutagenesis | + | 0.5900 | 59.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4086 | 40.86% |
Micronuclear | + | 0.5474 | 54.74% |
Hepatotoxicity | - | 0.6250 | 62.50% |
skin sensitisation | - | 0.8574 | 85.74% |
Respiratory toxicity | + | 0.8333 | 83.33% |
Reproductive toxicity | + | 0.8000 | 80.00% |
Mitochondrial toxicity | + | 0.8625 | 86.25% |
Nephrotoxicity | - | 0.6036 | 60.36% |
Acute Oral Toxicity (c) | III | 0.7155 | 71.55% |
Estrogen receptor binding | + | 0.8442 | 84.42% |
Androgen receptor binding | - | 0.5329 | 53.29% |
Thyroid receptor binding | - | 0.7445 | 74.45% |
Glucocorticoid receptor binding | + | 0.8982 | 89.82% |
Aromatase binding | + | 0.5375 | 53.75% |
PPAR gamma | + | 0.7847 | 78.47% |
Honey bee toxicity | - | 0.8638 | 86.38% |
Biodegradation | - | 0.6500 | 65.00% |
Crustacea aquatic toxicity | + | 0.5700 | 57.00% |
Fish aquatic toxicity | + | 0.7800 | 78.00% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
100 nM 15.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
39810.7 nM 3981.1 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
15848.9 nM 10000 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293235 | P02545 | Prelamin-A/C |
281.8 nM |
Potency |
via Super-PRED
|
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
31622.8 nM 31622.8 nM 31622.8 nM 31622.8 nM |
Potency Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.56% | 96.77% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 98.00% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.48% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 95.51% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.53% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.21% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.39% | 94.45% |
CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 86.21% | 81.29% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.00% | 93.99% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.76% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.45% | 99.23% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.73% | 82.67% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.33% | 85.14% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 84.27% | 91.00% |
CHEMBL3384 | Q16512 | Protein kinase N1 | 83.70% | 80.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.54% | 100.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.62% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.30% | 89.00% |
CHEMBL2083 | P15090 | Fatty acid binding protein adipocyte | 80.60% | 95.71% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.57% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.50% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Corydalis decumbens |
Corydalis govaniana |
Corydalis intermedia |
Fumaria parviflora |
Fumaria vaillantii |
PubChem | 185838 |
NPASS | NPC72788 |
ChEMBL | CHEMBL1316579 |
LOTUS | LTS0220618 |
wikiData | Q104392022 |