(+)-aspersclerolide D
| Internal ID | f3ac3bf1-4088-41c4-8b62-c07811b0903f |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans |
| IUPAC Name | (2S,3R)-7-hydroxy-4'-methoxy-3,5-dimethylspiro[3,4-dihydrochromene-2,5'-furan]-2'-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H16O5/c1-8-4-10(16)6-12-11(8)5-9(2)15(19-12)13(18-3)7-14(17)20-15/h4,6-7,9,16H,5H2,1-3H3/t9-,15+/m1/s1 |
| InChI Key | XWMWNVWBHJDLED-PSLIRLAXSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 2.40 |
| (2S,3R)-7-hydroxy-4'-methoxy-3,5-dimethylspiro(3,4-dihydrochromene-2,5'-furan)-2'-one |
| (2S,3R)-7-hydroxy-4'-methoxy-3,5-dimethylspiro[3,4-dihydrochromene-2,5'-furan]-2'-one |
| RefChem:67280 |
| CHEBI:206122 |
| (2S,3R)-7-hydroxy-4'-methoxy-3,5-dimethylspiro[3,4-dihydrochromene-2,5'-uran]-2'-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.38% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.25% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.67% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.87% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.99% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.35% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.56% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.26% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.20% | 94.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.14% | 92.94% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.61% | 82.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.44% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.16% | 94.45% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.11% | 94.80% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.01% | 93.40% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 83.73% | 86.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.41% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146682632 |
| LOTUS | LTS0125728 |
| wikiData | Q105343618 |