(-)-6-epi-notoamide I
| Internal ID | 70695628-20bd-4833-a8ba-e7ddaf416cf6 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Pyrroloquinolines |
| IUPAC Name | (1S,17S,19R)-9,9,16,16-tetramethyl-8-oxa-14,23,25-triazaheptacyclo[17.5.2.01,17.03,15.04,13.07,12.019,23]hexacosa-3(15),4(13),5,7(12),10-pentaene-2,24,26-trione |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC3=C2NC4=C3C(=O)C56C(C4(C)C)CC7(CCCN7C5=O)C(=O)N6)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC3=C2NC4=C3C(=O)[C@@]56[C@H](C4(C)C)C[C@]7(CCCN7C5=O)C(=O)N6)C |
| InChI | InChI=1S/C26H27N3O4/c1-23(2)10-8-13-15(33-23)7-6-14-17-19(27-18(13)14)24(3,4)16-12-25-9-5-11-29(25)22(32)26(16,20(17)30)28-21(25)31/h6-8,10,16,27H,5,9,11-12H2,1-4H3,(H,28,31)/t16-,25+,26-/m0/s1 |
| InChI Key | CDJZXTFDGOKTOT-HKFLSJHISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.20015635 g/mol |
| Topological Polar Surface Area (TPSA) | 91.50 Ų |
| XlogP | 3.10 |
| (1S,17S,19R)-9,9,16,16-tetramethyl-8-oxa-14,23,25-triazaheptacyclo[17.5.2.01,17.03,15.04,13.07,12.019,23]hexacosa-3(15),4(13),5,7(12),10-pentaene-2,24,26-trione |
| (1S,17S,19R)-9,9,16,16-tetramethyl-8-oxa-14,23,25-triazaheptacyclo(17.5.2.01,17.03,15.04,13.07,12.019,23)hexacosa-3(15),4(13),5,7(12),10-pentaene-2,24,26-trione |
| RefChem:67667 |
| CHEBI:217613 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.06% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.09% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 97.21% | 93.40% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.61% | 96.77% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.93% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.72% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.61% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.09% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.08% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.96% | 97.25% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.10% | 93.99% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.63% | 98.59% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.13% | 95.56% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 89.56% | 93.04% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.43% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.71% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.68% | 90.00% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 87.00% | 88.56% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.07% | 94.80% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.05% | 100.00% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 83.98% | 80.96% |
| CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 83.41% | 90.00% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 83.17% | 98.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.63% | 95.89% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.46% | 96.67% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 80.70% | 99.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 132487496 |
| LOTUS | LTS0097880 |
| wikiData | Q104954530 |