(+)-2,6-Dihydro-2-(4-hydroxy-4-methyl-2-penten-1-yl)-2,6-dimethyl-5H-pyrano[3,2-c]quinolin-5-one
| Internal ID | fa75bd5f-25d7-40cd-b380-6231d044e360 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Pyranoquinolines |
| IUPAC Name | 2-(4-hydroxy-4-methylpent-2-enyl)-2,6-dimethylpyrano[3,2-c]quinolin-5-one |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C3=CC=CC=C3N(C2=O)C)CC=CC(C)(C)O |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C3=CC=CC=C3N(C2=O)C)CC=CC(C)(C)O |
| InChI | InChI=1S/C20H23NO3/c1-19(2,23)11-7-12-20(3)13-10-15-17(24-20)14-8-5-6-9-16(14)21(4)18(15)22/h5-11,13,23H,12H2,1-4H3 |
| InChI Key | QEKDXAXUTISDJG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.16779360 g/mol |
| Topological Polar Surface Area (TPSA) | 49.80 Ų |
| XlogP | 2.50 |
| (+)-2,6-Dihydro-2-(4-hydroxy-4-methyl-2-penten-1-yl)-2,6-dimethyl-5H-pyrano[3,2-c]quinolin-5-one |
| 198336-56-0 |
![2D Structure of (+)-2,6-Dihydro-2-(4-hydroxy-4-methyl-2-penten-1-yl)-2,6-dimethyl-5H-pyrano[3,2-c]quinolin-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/-26-dihydro-2-4-hydroxy-4-methyl-2-penten-1-yl-26-dimethyl-5h-pyrano32-cquinolin-5-one.jpg "2D Structure of (+)-2,6-Dihydro-2-(4-hydroxy-4-methyl-2-penten-1-yl)-2,6-dimethyl-5H-pyrano[3,2-c]quinolin-5-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.73% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.35% | 98.95% |
| CHEMBL240 | Q12809 | HERG | 96.17% | 89.76% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.54% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.71% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.27% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.84% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.69% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.41% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.29% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.67% | 97.25% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.21% | 98.59% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 90.00% | 85.94% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.82% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum simulans |
| PubChem | 78385470 |
| LOTUS | LTS0260102 |
| wikiData | Q105219261 |