(+)-11alpha-Hydroxyerytravine
| Internal ID | 6ba0f59e-0df4-438a-9a19-a5fb8d34877e |
| Taxonomy | Alkaloids and derivatives > Erythrina alkaloids > Erythrinanes |
| IUPAC Name | (2R,9S,13bS)-11,12-dimethoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinoline-2,9-diol |
| SMILES (Canonical) | COC1=C(C=C2C(=C1)C(CN3C24CC(C=CC4=CC3)O)O)OC |
| SMILES (Isomeric) | COC1=C(C=C2C(=C1)[C@@H](CN3[C@]24C[C@H](C=CC4=CC3)O)O)OC |
| InChI | InChI=1S/C18H21NO4/c1-22-16-7-13-14(8-17(16)23-2)18-9-12(20)4-3-11(18)5-6-19(18)10-15(13)21/h3-5,7-8,12,15,20-21H,6,9-10H2,1-2H3/t12-,15+,18-/m0/s1 |
| InChI Key | LRCYONYSPOTFTD-PNPHSEOMSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 62.20 Ų |
| XlogP | 0.50 |
| CHEMBL218056 |
| SCHEMBL14021743 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.29% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.83% | 92.94% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.57% | 85.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.84% | 97.25% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.96% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.33% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.06% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.43% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.40% | 94.45% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.38% | 89.62% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.05% | 91.03% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.85% | 98.95% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.33% | 97.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.37% | 93.99% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.21% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina verna |
| PubChem | 11695361 |
| LOTUS | LTS0208581 |
| wikiData | Q105156063 |