Trichokonin-Ib
| Internal ID | 18a21aa6-fc26-4273-a179-1edf87254968 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | 2-[2-[[2-[2-[[2-[[2-[(2-acetamido-2-methylpropanoyl)amino]acetyl]amino]-2-methylpropanoyl]amino]propanoylamino]-2-methylpropanoyl]amino]propanoylamino]-N-[1-[[1-[[1-[[2-[[1-[[1-[2-[[1-[[1-[[1-[[5-amino-1-[[5-amino-1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-1,5-dioxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-methyl-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]pentanediamide |
| SMILES (Canonical) | CC(C)CC(C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CCC(=O)N)C(=O)NC(CC2=CC=CC=C2)CO)NC(=O)CNC(=O)C(C)(C)NC(=O)C(C(C)C)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)CNC(=O)C(C)(C)NC(=O)C |
| SMILES (Isomeric) | CC(C)CC(C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CCC(=O)N)C(=O)NC(CC2=CC=CC=C2)CO)NC(=O)CNC(=O)C(C)(C)NC(=O)C(C(C)C)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)CNC(=O)C(C)(C)NC(=O)C |
| InChI | InChI=1S/C89H147N23O24/c1-45(2)40-56(70(125)108-89(24,25)81(136)112-39-29-32-57(112)71(126)102-63(46(3)4)72(127)110-88(22,23)80(135)111-87(20,21)78(133)101-54(34-37-59(91)116)68(123)100-53(33-36-58(90)115)67(122)97-52(44-113)41-51-30-27-26-28-31-51)98-61(118)42-93-75(130)83(12,13)109-73(128)64(47(5)6)103-79(134)86(18,19)107-69(124)55(35-38-60(92)117)99-65(120)48(7)95-77(132)85(16,17)106-66(121)49(8)96-76(131)84(14,15)105-62(119)43-94-74(129)82(10,11)104-50(9)114/h26-28,30-31,45-49,52-57,63-64,113H,29,32-44H2,1-25H3,(H2,90,115)(H2,91,116)(H2,92,117)(H,93,130)(H,94,129)(H,95,132)(H,96,131)(H,97,122)(H,98,118)(H,99,120)(H,100,123)(H,101,133)(H,102,126)(H,103,134)(H,104,114)(H,105,119)(H,106,121)(H,107,124)(H,108,125)(H,109,128)(H,110,127)(H,111,135) |
| InChI Key | FATPXEYUKIVQRZ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C89H147N23O24 |
| Molecular Weight | 1923.30 g/mol |
| Exact Mass | 1922.09893265 g/mol |
| Topological Polar Surface Area (TPSA) | 723.00 Ų |
| XlogP | -3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.97% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.59% | 96.61% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.68% | 98.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.68% | 96.09% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 97.65% | 94.45% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 97.13% | 95.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.41% | 93.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.81% | 90.17% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 95.67% | 97.64% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.25% | 91.11% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 95.16% | 97.14% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 94.57% | 98.24% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 94.39% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.91% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.77% | 91.19% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 93.05% | 96.03% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.77% | 100.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.05% | 82.69% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 91.74% | 93.33% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.65% | 93.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 91.62% | 97.23% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.70% | 100.00% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 90.59% | 98.94% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.51% | 96.47% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.31% | 99.17% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.89% | 95.17% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 88.43% | 83.14% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 87.34% | 88.42% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.17% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.00% | 95.89% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 85.91% | 92.80% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 85.86% | 83.10% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 85.77% | 81.29% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.75% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.70% | 94.45% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 85.25% | 86.67% |
| CHEMBL5028 | O14672 | ADAM10 | 84.09% | 97.50% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 84.08% | 97.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.98% | 98.75% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 83.73% | 96.67% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.41% | 95.89% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.18% | 95.38% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 82.35% | 89.33% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 81.87% | 96.67% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 81.38% | 82.86% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.29% | 95.83% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.78% | 90.71% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.43% | 93.03% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.29% | 95.50% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 80.13% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139587114 |
| LOTUS | LTS0039722 |
| wikiData | Q77521695 |