Terreustoxin I
| Internal ID | 5f620e37-7fa1-4de5-a8d7-539b6789bc21 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones |
| IUPAC Name | methyl (2S,4aS,4bR,10aS,12aS)-6-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-9,10-dihydro-4aH-naphtho[1,2-h]isochromene-2-carboxylate |
| SMILES (Canonical) | CC1(C(=O)CCC2(C1=C(C(=O)C3(C2=CC(=C)C4(C3C(=O)OC(C4=O)(C)C(=O)OC)C)C)O)C)C |
| SMILES (Isomeric) | C[C@@]12CCC(=O)C(C1=C(C(=O)[C@]3(C2=CC(=C)[C@@]4([C@@H]3C(=O)O[C@](C4=O)(C)C(=O)OC)C)C)O)(C)C |
| InChI | InChI=1S/C26H30O8/c1-12-11-13-23(4)10-9-14(27)22(2,3)16(23)15(28)18(29)25(13,6)17-19(30)34-26(7,21(32)33-8)20(31)24(12,17)5/h11,17,28H,1,9-10H2,2-8H3/t17-,23-,24+,25-,26-/m0/s1 |
| InChI Key | KHTDLEZHJSFANO-UTZZIKNXSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19406791 g/mol |
| Topological Polar Surface Area (TPSA) | 124.00 Ų |
| XlogP | 2.00 |
| methyl (2S,4aS,4bR,10aS,12aS)-6-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-9,10-dihydro-4aH-naphtho[1,2-h]isochromene-2-carboxylate |
| Methyl (1R,2S,5S,7S,11S)-17-hydroxy-1,5,7,11,15,15-hexamethyl-8-methylidene-3,6,14,18-tetraoxo-4-oxatetracyclo(8.8.0.0,.0,)octadeca-9,16-diene-5-carboxylic acid |
| Methyl (1R,2S,5S,7S,11S)-17-hydroxy-1,5,7,11,15,15-hexamethyl-8-methylidene-3,6,14,18-tetraoxo-4-oxatetracyclo[8.8.0.0,.0,]octadeca-9,16-diene-5-carboxylic acid |
| methyl (2S,4aS,4bR,10aS,12aS)-6-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-9,10-dihydro-4aH-naphtho(1,2-h)isochromene-2-carboxylate |
| RefChem:188142 |
| CHEBI:227722 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.97% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.50% | 94.45% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.26% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.46% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.83% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.38% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.21% | 91.19% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.23% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.62% | 85.14% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.04% | 92.88% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.81% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.88% | 98.95% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.17% | 85.30% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.80% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146682421 |
| LOTUS | LTS0218358 |
| wikiData | Q105141324 |