Taveuniamide G
| Internal ID | 9d11723e-9c8b-4e6a-ada1-caca33dadccc |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Carboxylic acid derivatives > Carboxylic acid amides > Acetamides |
| IUPAC Name | N-(1,1,15,15-tetrachloropentadec-1-en-3,12-diyn-8-yl)acetamide |
| SMILES (Canonical) | CC(=O)NC(CCCC#CCC(Cl)Cl)CCCC#CC=C(Cl)Cl |
| SMILES (Isomeric) | CC(=O)NC(CCCC#CCC(Cl)Cl)CCCC#CC=C(Cl)Cl |
| InChI | InChI=1S/C17H21Cl4NO/c1-14(23)22-15(10-6-2-4-8-12-16(18)19)11-7-3-5-9-13-17(20)21/h12,15,17H,2-3,6-7,10-11,13H2,1H3,(H,22,23) |
| InChI Key | UJHURGUGOWAGMH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H21Cl4NO |
| Molecular Weight | 397.20 g/mol |
| Exact Mass | 397.034775 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 6.00 |
| DTXSID601334707 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.90% | 91.11% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 92.56% | 92.29% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.01% | 97.21% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.97% | 96.09% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.05% | 96.95% |
| CHEMBL240 | Q12809 | HERG | 89.09% | 89.76% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.62% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.30% | 94.45% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.28% | 89.34% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.91% | 94.73% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.86% | 91.19% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.62% | 100.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.18% | 98.75% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.21% | 92.86% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.18% | 90.17% |
| CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 83.88% | 95.93% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.78% | 93.56% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.28% | 89.63% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.75% | 98.95% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.18% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21777622 |
| LOTUS | LTS0234235 |
| wikiData | Q77562083 |