spongiacidin C
| Internal ID | acc4e6cd-53ab-4e7b-9081-a354a6b4e34f |
| Taxonomy | Organoheterocyclic compounds > Azolidines > Imidazolidines > Hydantoins |
| IUPAC Name | (5Z)-5-(8-oxo-1,5,6,7-tetrahydropyrrolo[2,3-c]azepin-4-ylidene)imidazolidine-2,4-dione |
| SMILES (Canonical) | C1CNC(=O)C2=C(C1=C3C(=O)NC(=O)N3)C=CN2 |
| SMILES (Isomeric) | C\1CNC(=O)C2=C(/C1=C\3/C(=O)NC(=O)N3)C=CN2 |
| InChI | InChI=1S/C11H10N4O3/c16-9-7-5(1-3-12-7)6(2-4-13-9)8-10(17)15-11(18)14-8/h1,3,12H,2,4H2,(H,13,16)(H2,14,15,17,18)/b8-6- |
| InChI Key | MOYLWFAZPQYOGQ-VURMDHGXSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.07529019 g/mol |
| Topological Polar Surface Area (TPSA) | 103.00 Ų |
| XlogP | -0.90 |
| 193202-57-2 |
| (Z)-5-(8-Oxo-5,6,7,8-tetrahydropyrrolo[2,3-c]azepin-4(1H)-ylidene)imidazolidine-2,4-dione |
| CHEMBL448126 |
| SCHEMBL22480163 |
| BDBM50436152 |
| (5Z)-5-(8-oxo-1,5,6,7-tetrahydropyrrolo[2,3-c]azepin-4-ylidene)imidazolidine-2,4-dione |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.02% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.60% | 91.11% |
| CHEMBL262 | P49841 | Glycogen synthase kinase-3 beta | 92.14% | 95.72% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.96% | 95.56% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 87.36% | 95.64% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.83% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.54% | 90.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.13% | 98.59% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 85.40% | 98.03% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.03% | 97.79% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.19% | 97.09% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 83.04% | 88.84% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.36% | 93.04% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 82.29% | 91.38% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.69% | 94.75% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.64% | 93.03% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.21% | 93.99% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.79% | 90.17% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.77% | 95.83% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.72% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10634145 |
| LOTUS | LTS0128476 |
| wikiData | Q105169263 |