Spiroalbatene
| Internal ID | 1d89d525-6356-4d4a-ae48-0792418f9fc1 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1S,10S,11R,14S)-4,6,14-trimethyl-11-propan-2-yltetracyclo[8.4.0.01,5.04,9]tetradec-6-ene |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C20H32/c1-12(2)15-8-7-14(4)20-11-10-19(5)16(17(15)20)9-6-13(3)18(19)20/h6,12,14-18H,7-11H2,1-5H3/t14-,15+,16?,17-,18?,19?,20-/m0/s1 |
| InChI Key | XZXQKVKQRPCDPA-KZFKHOFZSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.250401021 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.28% | 97.25% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 89.89% | 86.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.31% | 94.75% |
| CHEMBL1871 | P10275 | Androgen Receptor | 87.64% | 96.43% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.51% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.47% | 95.89% |
| CHEMBL4072 | P07858 | Cathepsin B | 86.20% | 93.67% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.78% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.44% | 95.56% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.38% | 94.80% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.17% | 96.38% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.47% | 93.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.12% | 90.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.77% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.61% | 97.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.06% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139591536 |
| LOTUS | LTS0125349 |
| wikiData | Q105345246 |