Sparticolin B
| Internal ID | 6a820cd5-3678-4255-8c82-96a9560257d8 |
| Taxonomy | Benzenoids > Naphthalenes |
| IUPAC Name | (E,4E)-4-(5'-oxospiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,2'-cyclopent-3-ene]-1'-ylidene)but-2-enoic acid |
| SMILES (Canonical) | C1=CC2=C3C(=C1)OC4(C=CC(=O)C4=CC=CC(=O)O)OC3=CC=C2 |
| SMILES (Isomeric) | C1=CC2=C3C(=C1)OC\4(C=CC(=O)/C4=C\C=C\C(=O)O)OC3=CC=C2 |
| InChI | InChI=1S/C19H12O5/c20-14-10-11-19(13(14)6-3-9-17(21)22)23-15-7-1-4-12-5-2-8-16(24-19)18(12)15/h1-11H,(H,21,22)/b9-3+,13-6+ |
| InChI Key | ILFMNYPCSHWMFW-MVWOEZQMSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H12O5 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 3.10 |
| CHEMBL4464000 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.22% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.87% | 95.56% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.82% | 89.63% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.00% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.79% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.65% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.13% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.65% | 89.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.32% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145721245 |
| LOTUS | LTS0129505 |
| wikiData | Q105115164 |