Sipholenol M
| Internal ID | 992bc46f-518a-4599-9372-c12f7692f3e5 |
| Taxonomy | Organoheterocyclic compounds > Oxepanes |
| IUPAC Name | (3S,5aS,6S,7S,9aS)-6-[2-[(3R,4aS,5S,8aR)-3-hydroperoxy-5-hydroxy-2,5,8,8-tetramethyl-3,4,4a,6,7,8a-hexahydronaphthalen-1-yl]ethyl]-2,2,5a,7-tetramethyl-4,5,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-3,7-diol |
| SMILES (Canonical) | CC1=C(C2C(CC1OO)C(CCC2(C)C)(C)O)CCC3C4(CCC(C(OC4CCC3(C)O)(C)C)O)C |
| SMILES (Isomeric) | CC1=C([C@@H]2[C@H](C[C@H]1OO)[C@@](CCC2(C)C)(C)O)CC[C@H]3[C@@]4(CC[C@@H](C(O[C@H]4CC[C@]3(C)O)(C)C)O)C |
| InChI | InChI=1S/C30H52O6/c1-18-19(25-20(17-21(18)36-34)29(7,32)16-15-26(25,2)3)9-10-22-28(6)13-11-23(31)27(4,5)35-24(28)12-14-30(22,8)33/h20-25,31-34H,9-17H2,1-8H3/t20-,21+,22-,23-,24-,25+,28-,29-,30-/m0/s1 |
| InChI Key | CXYXLYVALJRWSW-CAEUIZDWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H52O6 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.37638937 g/mol |
| Topological Polar Surface Area (TPSA) | 99.40 Ų |
| XlogP | 3.40 |
| (3S,5aS,6S,7S,9aS)-6-(2-((3R,4aS,5S,8aR)-3-hydroperoxy-5-hydroxy-2,5,8,8-tetramethyl-3,4,4a,6,7,8a-hexahydronaphthalen-1-yl)ethyl)-2,2,5a,7-tetramethyl-4,5,6,8,9,9a-hexahydro-3H-benzo(b)oxepine-3,7-diol |
| (3S,5aS,6S,7S,9aS)-6-[2-[(3R,4aS,5S,8aR)-3-hydroperoxy-5-hydroxy-2,5,8,8-tetramethyl-3,4,4a,6,7,8a-hexahydronaphthalen-1-yl]ethyl]-2,2,5a,7-tetramethyl-4,5,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-3,7-diol |
| RefChem:183209 |
| 1169792-84-0 |
| CHEMBL562995 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.02% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.81% | 96.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 94.21% | 97.79% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 91.53% | 95.93% |
| CHEMBL233 | P35372 | Mu opioid receptor | 89.73% | 97.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.64% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.34% | 91.11% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 88.34% | 89.05% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.91% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.76% | 94.75% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.66% | 96.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.87% | 94.45% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.58% | 95.50% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.12% | 94.62% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.89% | 96.38% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.31% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.28% | 89.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.72% | 96.43% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.25% | 95.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.96% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 44234955 |
| LOTUS | LTS0113645 |
| wikiData | Q104972189 |