Schidigerasaponin C2
| Internal ID | ec9b8730-692c-45a5-b6fa-adcfbfd9ad79 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(1R,2S,4S,6R,7S,8R,9S,12S,13S,15S,16R,18R)-15-hydroxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CC(C(C5)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)O)C)C)OC18CCC(=C)CO8 |
| SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@H]5[C@@]4(C[C@@H]([C@@H](C5)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)C)C)O[C@]18CCC(=C)CO8 |
| InChI | InChI=1S/C39H62O14/c1-17-7-10-39(48-16-17)18(2)28-25(53-39)12-22-20-6-5-19-11-24(23(42)13-38(19,4)21(20)8-9-37(22,28)3)49-36-34(32(46)30(44)27(15-41)51-36)52-35-33(47)31(45)29(43)26(14-40)50-35/h18-36,40-47H,1,5-16H2,2-4H3/t18-,19+,20+,21-,22-,23-,24+,25-,26+,27+,28-,29+,30-,31-,32-,33+,34+,35-,36+,37-,38-,39+/m0/s1 |
| InChI Key | AQYRNJPPAIKAIO-UUTXUEGQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C39H62O14 |
| Molecular Weight | 754.90 g/mol |
| Exact Mass | 754.41395665 g/mol |
| Topological Polar Surface Area (TPSA) | 217.00 Ų |
| XlogP | 1.70 |
| schidigera-saponin C2 |
| CHEMBL501493 |
| CHEBI:192849 |
| DTXSID501124624 |
| 266997-36-8 |
| (2beta,3beta,5beta)-2-Hydroxyspirost-25(27)-en-3-yl 2-O-beta-D-glucopyranosyl-beta-D-galactopyranoside |
| (2S,3R,4S,5S,6R)-2-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(1R,2S,4S,6R,7S,8R,9S,12S,13S,15S,16R,18R)-15-hydroxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.53% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.28% | 91.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 94.76% | 100.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 92.80% | 98.10% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.03% | 97.09% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.76% | 96.21% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.67% | 95.93% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.20% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.81% | 94.45% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 87.26% | 95.38% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.20% | 97.79% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.07% | 95.89% |
| CHEMBL233 | P35372 | Mu opioid receptor | 85.06% | 97.93% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.65% | 96.61% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.33% | 95.89% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.70% | 92.86% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 83.39% | 97.86% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.25% | 93.18% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.90% | 95.58% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.42% | 92.94% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 81.29% | 89.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Yucca schidigera |
| PubChem | 10842790 |
| LOTUS | LTS0059485 |
| wikiData | Q104917168 |