PZ2Vvg4unh
| Internal ID | 28632f55-42c6-4f6e-8527-7233c77d6c29 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | [(1S,2S,5R,8R,9R,10R,13R,17S)-9-hydroxy-1-methyl-6-methylidene-12-oxo-11-oxapentacyclo[8.6.1.15,8.02,8.013,17]octadecan-13-yl]methyl acetate |
| SMILES (Canonical) | CC(=O)OCC12CCCC3(C1C(C(C45C3CCC(C4)C(=C)C5)O)OC2=O)C |
| SMILES (Isomeric) | CC(=O)OC[C@@]12CCC[C@@]3([C@@H]1[C@H]([C@@H]([C@]45[C@H]3CC[C@H](C4)C(=C)C5)O)OC2=O)C |
| InChI | InChI=1S/C22H30O5/c1-12-9-22-10-14(12)5-6-15(22)20(3)7-4-8-21(11-26-13(2)23)17(20)16(18(22)24)27-19(21)25/h14-18,24H,1,4-11H2,2-3H3/t14-,15+,16-,17+,18+,20+,21+,22+/m1/s1 |
| InChI Key | IINCIYXMKLMTLV-PFJVNDLRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 3.10 |
| UNII-PZ2VVG4UNH |
| 18-Acetoxy-7beta-hydroxykaurenolide |
| 52560-10-8 |
| ent-18-Acetoxy-6beta,7alpha-dihydroxykaur-16-en-19-oic acid 19,6-lactone |
| KAUR-16-EN-18-oic acid, 19-(acetyloxy)-6,7-dihydroxy-, gamma-lactone, (4alpha,6alpha,7beta)- |
| 18-ACETOXY-7.BETA.-HYDROXYKAURENOLIDE |
| ENT-18-ACETOXY-6.BETA.,7.ALPHA.-DIHYDROXYKAUR-16-EN-19-OIC ACID 19,6-LACTONE |
| KAUR-16-EN-18-OIC ACID, 19-(ACETYLOXY)-6,7-DIHYDROXY-, .GAMMA.-LACTONE, (4.ALPHA.,6.ALPHA.,7.BETA.)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.16% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.53% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.54% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.73% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.92% | 96.38% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.00% | 82.69% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.53% | 97.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.60% | 96.77% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.15% | 95.50% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.79% | 98.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.20% | 92.62% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.65% | 91.19% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.21% | 93.04% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.97% | 95.89% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.23% | 95.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.06% | 94.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.74% | 90.17% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.80% | 92.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.59% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162623858 |
| LOTUS | LTS0157730 |
| wikiData | Q105113628 |