Nitropyrrolin D
| Internal ID | d6ea636a-269b-487b-8ef2-2062a86969ef |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (2R,3E,6E)-3,7,11-trimethyl-1-(5-nitro-1H-pyrrol-3-yl)dodeca-3,6,10-trien-2-ol |
| SMILES (Canonical) | CC(=CCCC(=CCC=C(C)C(CC1=CNC(=C1)[N+](=O)[O-])O)C)C |
| SMILES (Isomeric) | CC(=CCC/C(=C/C/C=C(\C)/[C@@H](CC1=CNC(=C1)[N+](=O)[O-])O)/C)C |
| InChI | InChI=1S/C19H28N2O3/c1-14(2)7-5-8-15(3)9-6-10-16(4)18(22)11-17-12-19(20-13-17)21(23)24/h7,9-10,12-13,18,20,22H,5-6,8,11H2,1-4H3/b15-9+,16-10+/t18-/m1/s1 |
| InChI Key | COVDAEBDAVGGFK-CIBVNXTLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.20999276 g/mol |
| Topological Polar Surface Area (TPSA) | 81.80 Ų |
| XlogP | 5.40 |
| CHEBI:70279 |
| CHEMBL1651437 |
| Q27138619 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.90% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.88% | 94.73% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.81% | 92.08% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.80% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.72% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.44% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.80% | 90.20% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.69% | 92.88% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.10% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.24% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.19% | 86.33% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.42% | 91.24% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 86.22% | 92.68% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 83.86% | 83.10% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.55% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 50908454 |
| LOTUS | LTS0102295 |
| wikiData | Q27138619 |