N-(3-Aminopropyl)-2-nitrobenzenamine
| Internal ID | 482b80ff-77b8-4231-a8bd-13f29f78332f |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Nitrobenzenes |
| IUPAC Name | N'-(2-nitrophenyl)propane-1,3-diamine |
| SMILES (Canonical) | C1=CC=C(C(=C1)NCCCN)[N+](=O)[O-] |
| SMILES (Isomeric) | C1=CC=C(C(=C1)NCCCN)[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N3O2/c10-6-3-7-11-8-4-1-2-5-9(8)12(13)14/h1-2,4-5,11H,3,6-7,10H2 |
| InChI Key | GVGDDEYVTBKACE-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.100776666 g/mol |
| Topological Polar Surface Area (TPSA) | 83.90 Ų |
| XlogP | 1.60 |
| KSJ78WBX6K |
| RefChem:826170 |
| 145315-42-0 |
| N'-(2-nitrophenyl)propane-1,3-diamine |
| N-(3-aminopropyl)-2-nitroaniline |
| N1-(2-NITROPHENYL)PROPANE-1,3-DIAMINE |
| N-(2-nitrophenyl)propane-1,3-diamine |
| 1,3-propanediamine, N-(2-nitrophenyl)-, hydrochloride |
| (3-aminopropyl)(2-nitrophenyl)amine |
| 1,3-Propanediamine, N-(2-nitrophenyl)- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 95.17% | 93.81% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.46% | 90.17% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 92.29% | 91.38% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 92.19% | 89.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.87% | 98.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.40% | 90.20% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.37% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.83% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.74% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.33% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.18% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.82% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.48% | 99.17% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.06% | 90.24% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.13% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 3581192 |
| LOTUS | LTS0084742 |
| wikiData | Q27097514 |