Minutissamide L
| Internal ID | 784475cb-2e73-465a-a2b7-a93eb5b5fbe2 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | 3-[(3S,6S,12S,15S,18S,21E,24S,27R,28R,31S)-3-(2-amino-2-oxoethyl)-21-ethylidene-27-hydroxy-15-[(1R)-1-hydroxyethyl]-6-[(1R)-1-methoxyethyl]-4-methyl-2,5,8,11,14,17,20,23,26,30-decaoxo-28-[(2S)-13-oxohexadecan-2-yl]-18,24-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,29-decazabicyclo[29.3.0]tetratriacontan-12-yl]propanamide |
| SMILES (Canonical) | CCCC(=O)CCCCCCCCCCC(C)C1C(C(=O)NC(C(=O)NC(=CC)C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)N(C(C(=O)N2CCCC2C(=O)N1)CC(=O)N)C)C(C)OC)CCC(=O)N)C(C)O)C(C)C)C(C)C)O |
| SMILES (Isomeric) | CCCC(=O)CCCCCCCCCC[C@H](C)[C@@H]1[C@H](C(=O)N[C@H](C(=O)N/C(=C/C)/C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N([C@H](C(=O)N2CCC[C@H]2C(=O)N1)CC(=O)N)C)[C@@H](C)OC)CCC(=O)N)[C@@H](C)O)C(C)C)C(C)C)O |
| InChI | InChI=1S/C59H100N12O16/c1-12-23-37(73)25-21-19-17-15-14-16-18-20-24-34(7)47-50(77)57(84)67-45(32(3)4)54(81)63-38(13-2)52(79)66-46(33(5)6)55(82)69-48(35(8)72)56(83)64-39(27-28-42(60)74)51(78)62-31-44(76)65-49(36(9)87-11)59(86)70(10)41(30-43(61)75)58(85)71-29-22-26-40(71)53(80)68-47/h13,32-36,39-41,45-50,72,77H,12,14-31H2,1-11H3,(H2,60,74)(H2,61,75)(H,62,78)(H,63,81)(H,64,83)(H,65,76)(H,66,79)(H,67,84)(H,68,80)(H,69,82)/b38-13+/t34-,35+,36+,39-,40-,41-,45-,46-,47+,48-,49-,50+/m0/s1 |
| InChI Key | OEHRGVTZXOKCIX-UTYYAIRYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C59H100N12O16 |
| Molecular Weight | 1233.50 g/mol |
| Exact Mass | 1232.73802515 g/mol |
| Topological Polar Surface Area (TPSA) | 426.00 Ų |
| XlogP | 1.90 |
| Atomic LogP (AlogP) | -1.00 |
| H-Bond Acceptor | 16 |
| H-Bond Donor | 12 |
| Rotatable Bonds | 24 |
| 3-[(3S,6S,12S,15S,18S,21E,24S,27R,28R,31S)-3-(2-amino-2-oxoethyl)-21-ethylidene-27-hydroxy-15-[(1R)-1-hydroxyethyl]-6-[(1R)-1-methoxyethyl]-4-methyl-2,5,8,11,14,17,20,23,26,30-decaoxo-28-[(2S)-13-oxohexadecan-2-yl]-18,24-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,29-decazabicyclo[29.3.0]tetratriacontan-12-yl]propanamide |
| 3-((3R,4R,7S,13S,16S,19S,25S,28S,33aS,E)-28-(2-amino-2-oxoethyl)-10-ethylidene-4-hydroxy-16-((R)-1-hydroxyethyl)-7,13-diisopropyl-25-((R)-1-methoxyethyl)-27-methyl-1,5,8,11,14,17,20,23,26,29-decaoxo-3-((S)-13-oxohexadecan-2-yl)dotriacontahydro-1H-pyrrolo(2,1-c)(1,4,7,10,13,16,19,22,25,28)decaazacyclohentriacontin-19-yl)propanamide |
| 3-((3R,4R,7S,13S,16S,19S,25S,28S,33aS,E)-28-(2-amino-2-oxoethyl)-10-ethylidene-4-hydroxy-16-((R)-1-hydroxyethyl)-7,13-diisopropyl-25-((R)-1-methoxyethyl)-27-methyl-1,5,8,11,14,17,20,23,26,29-decaoxo-3-((S)-13-oxohexadecan-2-yl)dotriacontahydro-1H-pyrrolo[2,1-c][1,4,7,10,13,16,19,22,25,28]decaazacyclohentriacontin-19-yl)propanamide |
| 3-((3S,6S,12S,15S,18S,21E,24S,27R,28R,31S)-3-(2-amino-2-oxoethyl)-21-ethylidene-27-hydroxy-15-((1R)-1-hydroxyethyl)-6-((1R)-1-methoxyethyl)-4-methyl-2,5,8,11,14,17,20,23,26,30-decaoxo-28-((2S)-13-oxohexadecan-2-yl)-18,24-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,29-decazabicyclo(29.3.0)tetratriacontan-12-yl)propanamide |
| RefChem:158981 |
| 3-((3R,4R,7S,10E,13S,16S,19S,25S,28S,33AS)-10-ethylidene-1,4,5,8,11,14,17,20,23-nonahydroxy-28-((C-hydroxycarbonimidoyl)methyl)-16-((1R)-1-hydroxyethyl)-25-((1R)-1-methoxyethyl)-27-methyl-26,29-dioxo-3-((2S)-13-oxohexadecan-2-yl)-7,13-bis(propan-2-yl)-3H,4H,7H,10H,13H,16H,19H,22H,25H,26H,27H,28H,29H,31H,32H,33H,33ah-pyrrolo(2,1-c)1,4,7,10,13,16,19,22,25,28-decaazacyclohentriacontan-19-yl)propanimidate |
| 3-((3R,4R,7S,13S,16S,19S,25S,28S,33AS)-10-ethylidene-1,4,5,8,11,14,17,20,23-nonahydroxy-28-((C-hydroxycarbonimidoyl)methyl)-16-((1R)-1-hydroxyethyl)-25-((1R)-1-methoxyethyl)-27-methyl-26,29-dioxo-3-((2S)-13-oxohexadecan-2-yl)-7,13-bis(propan-2-yl)-3H,4H,7H,10H,13H,16H,19H,22H,25H,26H,27H,28H,29H,31H,32H,33H,33ah-pyrrolo(2,1-c)1,4,7,10,13,16,19,22,25,28-decaazacyclohentriacontan-19-yl)propanimidate |
| 3-[(3R,4R,7S,10E,13S,16S,19S,25S,28S,33AS)-10-ethylidene-1,4,5,8,11,14,17,20,23-nonahydroxy-28-[(C-hydroxycarbonimidoyl)methyl]-16-[(1R)-1-hydroxyethyl]-25-[(1R)-1-methoxyethyl]-27-methyl-26,29-dioxo-3-[(2S)-13-oxohexadecan-2-yl]-7,13-bis(propan-2-yl)-3H,4H,7H,10H,13H,16H,19H,22H,25H,26H,27H,28H,29H,31H,32H,33H,33ah-pyrrolo[2,1-c]1,4,7,10,13,16,19,22,25,28-decaazacyclohentriacontan-19-yl]propanimidate |
| 3-[(3R,4R,7S,13S,16S,19S,25S,28S,33AS)-10-ethylidene-1,4,5,8,11,14,17,20,23-nonahydroxy-28-[(C-hydroxycarbonimidoyl)methyl]-16-[(1R)-1-hydroxyethyl]-25-[(1R)-1-methoxyethyl]-27-methyl-26,29-dioxo-3-[(2S)-13-oxohexadecan-2-yl]-7,13-bis(propan-2-yl)-3H,4H,7H,10H,13H,16H,19H,22H,25H,26H,27H,28H,29H,31H,32H,33H,33ah-pyrrolo[2,1-c]1,4,7,10,13,16,19,22,25,28-decaazacyclohentriacontan-19-yl]propanimidate |
| Minutibetaamide L |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6793 | 67.93% |
| Caco-2 | - | 0.8600 | 86.00% |
| Blood Brain Barrier | - | 0.7750 | 77.50% |
| Human oral bioavailability | - | 0.8000 | 80.00% |
| Subcellular localzation | Mitochondria | 0.4990 | 49.90% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8125 | 81.25% |
| OATP1B3 inhibitior | + | 0.9057 | 90.57% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.8817 | 88.17% |
| BSEP inhibitior | + | 0.9353 | 93.53% |
| P-glycoprotein inhibitior | + | 0.7423 | 74.23% |
| P-glycoprotein substrate | + | 0.8894 | 88.94% |
| CYP3A4 substrate | + | 0.7433 | 74.33% |
| CYP2C9 substrate | - | 0.7908 | 79.08% |
| CYP2D6 substrate | - | 0.8690 | 86.90% |
| CYP3A4 inhibition | - | 0.9065 | 90.65% |
| CYP2C9 inhibition | - | 0.8521 | 85.21% |
| CYP2C19 inhibition | - | 0.8739 | 87.39% |
| CYP2D6 inhibition | - | 0.9273 | 92.73% |
| CYP1A2 inhibition | - | 0.8842 | 88.42% |
| CYP2C8 inhibition | + | 0.7628 | 76.28% |
| CYP inhibitory promiscuity | - | 0.9878 | 98.78% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.5395 | 53.95% |
| Eye corrosion | - | 0.9842 | 98.42% |
| Eye irritation | - | 0.8964 | 89.64% |
| Skin irritation | - | 0.7548 | 75.48% |
| Skin corrosion | - | 0.9013 | 90.13% |
| Ames mutagenesis | - | 0.6737 | 67.37% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3727 | 37.27% |
| Micronuclear | + | 0.7700 | 77.00% |
| Hepatotoxicity | - | 0.5177 | 51.77% |
| skin sensitisation | - | 0.8644 | 86.44% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.9000 | 90.00% |
| Mitochondrial toxicity | + | 0.7500 | 75.00% |
| Nephrotoxicity | - | 0.6120 | 61.20% |
| Acute Oral Toxicity (c) | III | 0.6333 | 63.33% |
| Estrogen receptor binding | + | 0.6744 | 67.44% |
| Androgen receptor binding | + | 0.7093 | 70.93% |
| Thyroid receptor binding | + | 0.5755 | 57.55% |
| Glucocorticoid receptor binding | + | 0.6879 | 68.79% |
| Aromatase binding | + | 0.7387 | 73.87% |
| PPAR gamma | + | 0.7726 | 77.26% |
| Honey bee toxicity | - | 0.6796 | 67.96% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.5276 | 52.76% |
| Fish aquatic toxicity | - | 0.4461 | 44.61% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.78% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.58% | 98.95% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 99.01% | 95.92% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 98.57% | 94.66% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 98.42% | 94.75% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.22% | 83.82% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.19% | 90.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.90% | 94.45% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 97.84% | 82.38% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.57% | 91.11% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 96.55% | 93.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 96.06% | 95.89% |
| CHEMBL3837 | P07711 | Cathepsin L | 95.84% | 96.61% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 95.55% | 94.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 95.20% | 95.50% |
| CHEMBL4071 | P08311 | Cathepsin G | 95.06% | 94.64% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 94.80% | 92.97% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.55% | 90.17% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 94.18% | 96.31% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 93.47% | 97.05% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 92.35% | 100.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 92.19% | 91.03% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 92.14% | 95.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.07% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.84% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.02% | 97.09% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.84% | 98.59% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.53% | 90.71% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 89.24% | 92.50% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 88.98% | 92.12% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.82% | 95.56% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.68% | 95.93% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 88.27% | 95.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.83% | 100.00% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 87.47% | 88.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.40% | 89.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 87.08% | 97.64% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.00% | 93.03% |
| CHEMBL228 | P31645 | Serotonin transporter | 86.88% | 95.51% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 86.72% | 91.81% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.19% | 99.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.13% | 96.47% |
| CHEMBL1871 | P10275 | Androgen Receptor | 85.05% | 96.43% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.03% | 96.90% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.94% | 99.23% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 84.81% | 94.50% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 84.31% | 85.83% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.52% | 93.56% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.26% | 99.18% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.04% | 82.69% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.75% | 97.50% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.78% | 89.50% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.78% | 98.03% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 81.76% | 97.47% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.57% | 97.29% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.56% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683775 |
| LOTUS | LTS0014230 |
| wikiData | Q105190283 |