Methyl tumonoate B
| Internal ID | b83f95d3-89b1-49fe-9823-a8c9fd0cb41f |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides |
| IUPAC Name | [(2R,3S)-1-[(2S)-1-methoxy-1-oxopropan-2-yl]oxy-3-methyl-1-oxopentan-2-yl] (2S)-1-[(E,2R,3S)-3-hydroxy-2,4-dimethyldodec-4-enoyl]pyrrolidine-2-carboxylate |
| SMILES (Canonical) | CCCCCCCC=C(C)C(C(C)C(=O)N1CCCC1C(=O)OC(C(C)CC)C(=O)OC(C)C(=O)OC)O |
| SMILES (Isomeric) | CCCCCCC/C=C(\C)/[C@H]([C@@H](C)C(=O)N1CCC[C@H]1C(=O)O[C@H]([C@@H](C)CC)C(=O)O[C@@H](C)C(=O)OC)O |
| InChI | InChI=1S/C29H49NO8/c1-8-10-11-12-13-14-16-20(4)24(31)21(5)26(32)30-18-15-17-23(30)28(34)38-25(19(3)9-2)29(35)37-22(6)27(33)36-7/h16,19,21-25,31H,8-15,17-18H2,1-7H3/b20-16+/t19-,21+,22-,23-,24+,25+/m0/s1 |
| InChI Key | RYWKXTITOBZASH-DZOJKPGOSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C29H49NO8 |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.34581752 g/mol |
| Topological Polar Surface Area (TPSA) | 119.00 Ų |
| XlogP | 6.60 |
| Atomic LogP (AlogP) | 4.34 |
| H-Bond Acceptor | 8 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 16 |
| CHEBI:69214 |
| DTXSID701334079 |
| Q27137553 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7038 | 70.38% |
| Caco-2 | - | 0.6829 | 68.29% |
| Blood Brain Barrier | + | 0.6750 | 67.50% |
| Human oral bioavailability | - | 0.6000 | 60.00% |
| Subcellular localzation | Mitochondria | 0.5839 | 58.39% |
| OATP2B1 inhibitior | - | 0.7253 | 72.53% |
| OATP1B1 inhibitior | + | 0.8790 | 87.90% |
| OATP1B3 inhibitior | + | 0.9303 | 93.03% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.7750 | 77.50% |
| BSEP inhibitior | + | 0.6607 | 66.07% |
| P-glycoprotein inhibitior | + | 0.7688 | 76.88% |
| P-glycoprotein substrate | + | 0.6443 | 64.43% |
| CYP3A4 substrate | + | 0.6601 | 66.01% |
| CYP2C9 substrate | - | 0.6221 | 62.21% |
| CYP2D6 substrate | - | 0.8522 | 85.22% |
| CYP3A4 inhibition | - | 0.9216 | 92.16% |
| CYP2C9 inhibition | - | 0.7869 | 78.69% |
| CYP2C19 inhibition | - | 0.7354 | 73.54% |
| CYP2D6 inhibition | - | 0.8623 | 86.23% |
| CYP1A2 inhibition | - | 0.7272 | 72.72% |
| CYP2C8 inhibition | + | 0.5245 | 52.45% |
| CYP inhibitory promiscuity | - | 0.7891 | 78.91% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.8900 | 89.00% |
| Carcinogenicity (trinary) | Non-required | 0.5647 | 56.47% |
| Eye corrosion | - | 0.9833 | 98.33% |
| Eye irritation | - | 0.9251 | 92.51% |
| Skin irritation | - | 0.7774 | 77.74% |
| Skin corrosion | - | 0.9345 | 93.45% |
| Ames mutagenesis | - | 0.6800 | 68.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5244 | 52.44% |
| Micronuclear | + | 0.5600 | 56.00% |
| Hepatotoxicity | + | 0.5260 | 52.60% |
| skin sensitisation | - | 0.8662 | 86.62% |
| Respiratory toxicity | + | 0.5889 | 58.89% |
| Reproductive toxicity | + | 0.5778 | 57.78% |
| Mitochondrial toxicity | - | 0.5750 | 57.50% |
| Nephrotoxicity | - | 0.6255 | 62.55% |
| Acute Oral Toxicity (c) | III | 0.6597 | 65.97% |
| Estrogen receptor binding | + | 0.7148 | 71.48% |
| Androgen receptor binding | + | 0.6795 | 67.95% |
| Thyroid receptor binding | - | 0.6373 | 63.73% |
| Glucocorticoid receptor binding | + | 0.6840 | 68.40% |
| Aromatase binding | - | 0.5081 | 50.81% |
| PPAR gamma | - | 0.5127 | 51.27% |
| Honey bee toxicity | - | 0.8744 | 87.44% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | + | 0.6289 | 62.89% |
| Fish aquatic toxicity | + | 0.9113 | 91.13% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.88% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.77% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.79% | 97.25% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 95.32% | 92.12% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.66% | 92.86% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.02% | 89.63% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 92.71% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.12% | 97.29% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 91.76% | 97.47% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.70% | 99.17% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 91.16% | 91.81% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 90.84% | 99.18% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.81% | 93.56% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 90.68% | 98.33% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.36% | 95.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.22% | 91.19% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.00% | 94.45% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 89.74% | 94.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.59% | 96.47% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.52% | 100.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 88.61% | 94.66% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 88.35% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.32% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.81% | 95.89% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 86.88% | 98.03% |
| CHEMBL205 | P00918 | Carbonic anhydrase II | 86.79% | 98.44% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 86.38% | 95.36% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.26% | 93.03% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.18% | 96.95% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.38% | 96.38% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.37% | 96.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.26% | 92.50% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 85.01% | 96.00% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 84.97% | 98.24% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.75% | 97.09% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.73% | 95.71% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.68% | 98.75% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.64% | 100.00% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 84.56% | 95.27% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.17% | 97.21% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 83.96% | 94.05% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.79% | 91.11% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.77% | 90.71% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 83.28% | 82.38% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.16% | 94.00% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.81% | 97.50% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 82.20% | 96.76% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 82.20% | 95.00% |
| CHEMBL3691 | Q13822 | Autotaxin | 81.68% | 96.39% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.62% | 95.58% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 81.28% | 97.50% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 81.00% | 97.64% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.91% | 96.25% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.27% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10840160 |
| LOTUS | LTS0275082 |
| wikiData | Q27137553 |