Lodopyridone C
| Internal ID | 7795ce47-cf8b-4467-ac56-ec2bbf4b2ebf |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Haloquinolines > Chloroquinolines |
| IUPAC Name | 6-[2-(6-chloroquinolin-2-yl)-1,3-thiazol-4-yl]-N-(2-hydroxyethyl)-5-methoxy-1-methyl-3-methylsulfinyl-4-oxopyridine-2-carboxamide |
| SMILES (Canonical) | CN1C(=C(C(=O)C(=C1C(=O)NCCO)S(=O)C)OC)C2=CSC(=N2)C3=NC4=C(C=C3)C=C(C=C4)Cl |
| SMILES (Isomeric) | CN1C(=C(C(=O)C(=C1C(=O)NCCO)S(=O)C)OC)C2=CSC(=N2)C3=NC4=C(C=C3)C=C(C=C4)Cl |
| InChI | InChI=1S/C23H21ClN4O5S2/c1-28-17(20(33-2)19(30)21(35(3)32)18(28)22(31)25-8-9-29)16-11-34-23(27-16)15-6-4-12-10-13(24)5-7-14(12)26-15/h4-7,10-11,29H,8-9H2,1-3H3,(H,25,31) |
| InChI Key | WQBSEOMVTBWGGL-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C23H21ClN4O5S2 |
| Molecular Weight | 533.00 g/mol |
| Exact Mass | 532.0641898 g/mol |
| Topological Polar Surface Area (TPSA) | 169.00 Ų |
| XlogP | 1.90 |
| CHEMBL4084548 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 99.49% | 87.67% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 96.58% | 81.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.17% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.57% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.51% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.41% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.68% | 90.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.64% | 86.92% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.48% | 94.45% |
| CHEMBL4531 | P17931 | Galectin-3 | 91.03% | 96.90% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.47% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.14% | 96.00% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 87.15% | 94.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.07% | 93.03% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.21% | 95.93% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.00% | 92.62% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 85.56% | 87.45% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.20% | 96.90% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.57% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.40% | 95.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.49% | 96.77% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.30% | 91.11% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 82.10% | 96.47% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 82.09% | 85.49% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.94% | 100.00% |
| CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 80.86% | 87.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.85% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 137645189 |
| LOTUS | LTS0217126 |
| wikiData | Q105310324 |