Indole-5,6-quinone
| Internal ID | a2477593-baa5-44c9-a847-63f4068bbed8 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives |
| IUPAC Name | 1H-indole-5,6-dione |
| SMILES (Canonical) | C1=CNC2=CC(=O)C(=O)C=C21 |
| SMILES (Isomeric) | C1=CNC2=CC(=O)C(=O)C=C21 |
| InChI | InChI=1S/C8H5NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h1-4,9H |
| InChI Key | IGGVVGHJSQSLFO-UHFFFAOYSA-N |
| Popularity | 193 references in papers |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.032028402 g/mol |
| Topological Polar Surface Area (TPSA) | 46.20 Ų |
| XlogP | -0.30 |
| 1H-indole-5,6-dione |
| 582-59-2 |
| Indole-5,6-dione |
| SE4DX7HKA2 |
| 6-Hydroxy-5H-indol-5-one |
| indolequinone |
| indole-5,6 quinone |
| UNII-SE4DX7HKA2 |
| C05579 |
| 59719-88-9 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 88.49% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.20% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.39% | 91.11% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 84.52% | 83.10% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 83.94% | 98.59% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.44% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 440728 |
| LOTUS | LTS0185030 |
| wikiData | Q6025729 |