Ilicicolin I
| Internal ID | e8b8579d-3792-40d1-96d2-d57d845c997a |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Phenylpyridines |
| IUPAC Name | 3-[3-[(1R,2R,4aS,6R,8aR)-1,2,4a,6-tetramethyl-2,5,6,7,8,8a-hexahydronaphthalen-1-yl]prop-2-enoyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
| SMILES (Canonical) | CC1CCC2C(C1)(C=CC(C2(C)C=CC(=O)C3=C(C(=CNC3=O)C4=CC=C(C=C4)O)O)C)C |
| SMILES (Isomeric) | C[C@@H]1CC[C@@H]2[C@@](C1)(C=C[C@H]([C@@]2(C)C=CC(=O)C3=C(C(=CNC3=O)C4=CC=C(C=C4)O)O)C)C |
| InChI | InChI=1S/C28H33NO4/c1-17-5-10-23-27(3,15-17)13-11-18(2)28(23,4)14-12-22(31)24-25(32)21(16-29-26(24)33)19-6-8-20(30)9-7-19/h6-9,11-14,16-18,23,30H,5,10,15H2,1-4H3,(H2,29,32,33)/t17-,18-,23-,27-,28-/m1/s1 |
| InChI Key | PUXIVBOHLPMCTR-QEZWGDMUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.24095853 g/mol |
| Topological Polar Surface Area (TPSA) | 86.60 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.48% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.02% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.36% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.54% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.83% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.79% | 94.75% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 91.56% | 91.71% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.33% | 97.79% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.04% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.71% | 98.95% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 87.70% | 95.64% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 87.52% | 97.64% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.88% | 97.28% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 86.51% | 83.10% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.79% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.33% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.74% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.90% | 91.49% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.69% | 93.10% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.32% | 85.11% |
| CHEMBL268 | P43235 | Cathepsin K | 82.31% | 96.85% |
| CHEMBL4924 | Q9UK32 | Ribosomal protein S6 kinase alpha 6 | 81.96% | 80.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.72% | 92.94% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.54% | 92.88% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.29% | 98.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139590514 |
| LOTUS | LTS0040710 |
| wikiData | Q105215336 |