Hydroxyiso-9-methylstreptimidone
| Internal ID | 6eaafe35-aa63-4da0-8abc-cda843a0342d |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Alpha,beta-unsaturated ketones > b-hydroxy-alpha,beta-unsaturated ketones |
| IUPAC Name | 4-[(2R,5E,7E)-2,9-dihydroxy-5,7-dimethyl-4-oxodeca-5,7-dienyl]piperidine-2,6-dione |
| SMILES (Canonical) | CC(C=C(C)C=C(C)C(=O)CC(CC1CC(=O)NC(=O)C1)O)O |
| SMILES (Isomeric) | CC(/C=C(\C)/C=C(\C)/C(=O)C[C@@H](CC1CC(=O)NC(=O)C1)O)O |
| InChI | InChI=1S/C17H25NO5/c1-10(5-12(3)19)4-11(2)15(21)9-14(20)6-13-7-16(22)18-17(23)8-13/h4-5,12-14,19-20H,6-9H2,1-3H3,(H,18,22,23)/b10-5+,11-4+/t12?,14-/m1/s1 |
| InChI Key | TXVQYPQDJZPPHL-AEKKGRRGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17327290 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.56% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.94% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.64% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.84% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.37% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.12% | 85.14% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.72% | 90.08% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.21% | 95.56% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 85.46% | 88.56% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.92% | 85.11% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.56% | 98.59% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.39% | 91.07% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.53% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.01% | 99.17% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.87% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145720690 |
| LOTUS | LTS0124951 |
| wikiData | Q105267039 |