19-Decanoyl-13-methyl-16-(2-methylpropyl)-4-propan-2-yl-25-thia-2,5,11,14,17,22-hexazatricyclo[18.3.2.07,11]pentacosane-3,6,12,15,18,23-hexone
| Internal ID | c3aeff97-ea4a-4cd8-82df-327ab80aae18 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 19-decanoyl-13-methyl-16-(2-methylpropyl)-4-propan-2-yl-25-thia-2,5,11,14,17,22-hexazatricyclo[18.3.2.07,11]pentacosane-3,6,12,15,18,23-hexone |
| SMILES (Canonical) | CCCCCCCCCC(=O)C1C2CNC(=O)C(CS2)NC(=O)C(NC(=O)C3CCCN3C(=O)C(NC(=O)C(NC1=O)CC(C)C)C)C(C)C |
| SMILES (Isomeric) | CCCCCCCCCC(=O)C1C2CNC(=O)C(CS2)NC(=O)C(NC(=O)C3CCCN3C(=O)C(NC(=O)C(NC1=O)CC(C)C)C)C(C)C |
| InChI | InChI=1S/C36H60N6O7S/c1-7-8-9-10-11-12-13-16-27(43)29-28-19-37-31(44)25(20-50-28)40-35(48)30(22(4)5)41-33(46)26-15-14-17-42(26)36(49)23(6)38-32(45)24(18-21(2)3)39-34(29)47/h21-26,28-30H,7-20H2,1-6H3,(H,37,44)(H,38,45)(H,39,47)(H,40,48)(H,41,46) |
| InChI Key | WDKYFUSPNIQGDO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C36H60N6O7S |
| Molecular Weight | 721.00 g/mol |
| Exact Mass | 720.42441945 g/mol |
| Topological Polar Surface Area (TPSA) | 208.00 Ų |
| XlogP | 4.70 |
| Atomic LogP (AlogP) | 2.21 |
| H-Bond Acceptor | 8 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 12 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7272 | 72.72% |
| Caco-2 | - | 0.8428 | 84.28% |
| Blood Brain Barrier | - | 0.6500 | 65.00% |
| Human oral bioavailability | - | 0.6000 | 60.00% |
| Subcellular localzation | Lysosomes | 0.5648 | 56.48% |
| OATP2B1 inhibitior | + | 0.7075 | 70.75% |
| OATP1B1 inhibitior | + | 0.8408 | 84.08% |
| OATP1B3 inhibitior | + | 0.9246 | 92.46% |
| MATE1 inhibitior | - | 0.8600 | 86.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.9134 | 91.34% |
| P-glycoprotein inhibitior | + | 0.7404 | 74.04% |
| P-glycoprotein substrate | + | 0.8495 | 84.95% |
| CYP3A4 substrate | + | 0.6766 | 67.66% |
| CYP2C9 substrate | + | 0.5861 | 58.61% |
| CYP2D6 substrate | - | 0.8386 | 83.86% |
| CYP3A4 inhibition | - | 0.7729 | 77.29% |
| CYP2C9 inhibition | - | 0.8327 | 83.27% |
| CYP2C19 inhibition | - | 0.7774 | 77.74% |
| CYP2D6 inhibition | - | 0.8742 | 87.42% |
| CYP1A2 inhibition | - | 0.8855 | 88.55% |
| CYP2C8 inhibition | + | 0.6064 | 60.64% |
| CYP inhibitory promiscuity | - | 0.9555 | 95.55% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8300 | 83.00% |
| Carcinogenicity (trinary) | Non-required | 0.6169 | 61.69% |
| Eye corrosion | - | 0.9849 | 98.49% |
| Eye irritation | - | 0.9042 | 90.42% |
| Skin irritation | - | 0.7774 | 77.74% |
| Skin corrosion | - | 0.8956 | 89.56% |
| Ames mutagenesis | - | 0.7237 | 72.37% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5346 | 53.46% |
| Micronuclear | + | 0.6600 | 66.00% |
| Hepatotoxicity | + | 0.6375 | 63.75% |
| skin sensitisation | - | 0.8671 | 86.71% |
| Respiratory toxicity | + | 0.7667 | 76.67% |
| Reproductive toxicity | + | 0.7889 | 78.89% |
| Mitochondrial toxicity | + | 0.7750 | 77.50% |
| Nephrotoxicity | + | 0.5937 | 59.37% |
| Acute Oral Toxicity (c) | III | 0.6698 | 66.98% |
| Estrogen receptor binding | + | 0.7637 | 76.37% |
| Androgen receptor binding | + | 0.6463 | 64.63% |
| Thyroid receptor binding | + | 0.5441 | 54.41% |
| Glucocorticoid receptor binding | + | 0.6511 | 65.11% |
| Aromatase binding | + | 0.6727 | 67.27% |
| PPAR gamma | + | 0.6459 | 64.59% |
| Honey bee toxicity | - | 0.8539 | 85.39% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.7678 | 76.78% |
| Fish aquatic toxicity | + | 0.7374 | 73.74% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.70% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.04% | 96.09% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 96.10% | 92.97% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.99% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.96% | 97.25% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 95.27% | 97.05% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.56% | 90.08% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 94.32% | 96.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.96% | 85.14% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.20% | 90.71% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.98% | 83.82% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.90% | 95.50% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 92.44% | 95.92% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 92.33% | 96.31% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.09% | 94.45% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 91.72% | 95.62% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 91.45% | 98.03% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 91.39% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.37% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.62% | 99.23% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.53% | 97.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.48% | 93.56% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 89.23% | 82.38% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 89.20% | 94.66% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.20% | 100.00% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 88.93% | 91.81% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.60% | 92.88% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.59% | 93.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.40% | 96.47% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 87.27% | 97.64% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.00% | 93.03% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.77% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 86.28% | 95.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.84% | 99.18% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.73% | 98.33% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 85.69% | 92.32% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 85.67% | 90.24% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.63% | 92.50% |
| CHEMBL1949 | P62937 | Cyclophilin A | 85.12% | 98.57% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 84.79% | 95.27% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.71% | 96.90% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 84.12% | 94.50% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.88% | 91.03% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.32% | 90.24% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.31% | 92.86% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.17% | 97.50% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.95% | 88.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.52% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.22% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.92% | 95.89% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.78% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.07% | 95.56% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 80.72% | 96.33% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.51% | 82.69% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 80.42% | 98.59% |
| CHEMBL4071 | P08311 | Cathepsin G | 80.16% | 94.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 75304925 |
| LOTUS | LTS0258218 |
| wikiData | Q104200122 |