N-[(E,4S,5R,9R,10R,11R)-11-[(3R,5E,7E,11R,12S,13E,15R,17S,18S,19E,21R,23S,24R,25S,29S)-29-hydroxy-3,15,17,21,23-pentamethoxy-5,12,18,24-tetramethyl-9,27-dioxo-10,26-dioxabicyclo[23.3.1]nonacosa-1(28),5,7,13,19-pentaen-11-yl]-4,10-dimethoxy-5,9-dimethyl-6-oxododec-1-enyl]-N-methylformamide
| Internal ID | b00a7074-1354-47b8-8c05-327ab7c12960 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | N-[(E,4S,5R,9R,10R,11R)-11-[(3R,5E,7E,11R,12S,13E,15R,17S,18S,19E,21R,23S,24R,25S,29S)-29-hydroxy-3,15,17,21,23-pentamethoxy-5,12,18,24-tetramethyl-9,27-dioxo-10,26-dioxabicyclo[23.3.1]nonacosa-1(28),5,7,13,19-pentaen-11-yl]-4,10-dimethoxy-5,9-dimethyl-6-oxododec-1-enyl]-N-methylformamide |
| SMILES (Canonical) | CC1C=CC(CC(C(C2C(C(=CC(=O)O2)CC(CC(=CC=CC(=O)OC(C(C=CC(CC1OC)OC)C)C(C)C(C(C)CCC(=O)C(C)C(CC=CN(C)C=O)OC)OC)C)OC)O)C)OC)OC |
| SMILES (Isomeric) | C[C@H]1/C=C/[C@@H](C[C@@H]([C@H]([C@H]2[C@H](C(=CC(=O)O2)C[C@@H](C/C(=C/C=C/C(=O)O[C@H]([C@H](/C=C/[C@@H](C[C@@H]1OC)OC)C)[C@H](C)[C@@H]([C@H](C)CCC(=O)[C@H](C)[C@H](C/C=C/N(C)C=O)OC)OC)/C)OC)O)C)OC)OC |
| InChI | InChI=1S/C54H87NO14/c1-34-18-16-20-49(58)68-53(40(7)52(67-15)36(3)23-26-45(57)38(5)46(64-12)19-17-27-55(8)33-56)37(4)22-25-42(61-9)31-47(65-13)35(2)21-24-43(62-10)32-48(66-14)39(6)54-51(60)41(30-50(59)69-54)29-44(28-34)63-11/h16-18,20-22,24-25,27,30,33,35-40,42-44,46-48,51-54,60H,19,23,26,28-29,31-32H2,1-15H3/b20-16+,24-21+,25-22+,27-17+,34-18+/t35-,36+,37-,38-,39+,40+,42-,43-,44+,46-,47-,48-,51-,52+,53+,54-/m0/s1 |
| InChI Key | LDRCIZMRSWUAMW-GTGWSDFISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C54H87NO14 |
| Molecular Weight | 974.30 g/mol |
| Exact Mass | 973.61265645 g/mol |
| Topological Polar Surface Area (TPSA) | 175.00 Ų |
| XlogP | 6.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.85% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.98% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.39% | 95.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.25% | 90.08% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 92.06% | 85.31% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.53% | 91.19% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.72% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.62% | 97.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.53% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.46% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.43% | 94.45% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.08% | 91.07% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.97% | 96.77% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.98% | 89.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.76% | 96.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.52% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.46% | 99.23% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.23% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.00% | 100.00% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.47% | 82.38% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.46% | 97.79% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.37% | 98.75% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.32% | 97.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.96% | 90.71% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.59% | 96.90% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.19% | 94.73% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.10% | 96.47% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.47% | 100.00% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 81.00% | 97.56% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.85% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162930289 |
| LOTUS | LTS0083750 |
| wikiData | Q105150337 |