Diazaquinomycin H
| Internal ID | 9da6a2bd-dc67-4dd3-b6ce-32bf9562dfaf |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinoline quinones |
| IUPAC Name | 6-methyl-4-(7-methyloctyl)-1,9-dihydropyrido[3,2-g]quinoline-2,5,8,10-tetrone |
| SMILES (Canonical) | CC1=CC(=O)NC2=C1C(=O)C3=C(C2=O)NC(=O)C=C3CCCCCCC(C)C |
| SMILES (Isomeric) | CC1=CC(=O)NC2=C1C(=O)C3=C(C2=O)NC(=O)C=C3CCCCCCC(C)C |
| InChI | InChI=1S/C22H26N2O4/c1-12(2)8-6-4-5-7-9-14-11-16(26)24-20-18(14)21(27)17-13(3)10-15(25)23-19(17)22(20)28/h10-12H,4-9H2,1-3H3,(H,23,25)(H,24,26) |
| InChI Key | ZMMKQTMMGUIIJM-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.18925731 g/mol |
| Topological Polar Surface Area (TPSA) | 92.30 Ų |
| XlogP | 3.10 |
| DAQH |
| 6-methyl-4-(7-methyloctyl)-1,9-dihydropyrido[3,2-g]quinoline-2,5,8,10-tetrone |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.01% | 98.95% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 95.48% | 94.80% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.73% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.03% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.61% | 90.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.02% | 94.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.25% | 91.11% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.53% | 98.59% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 89.22% | 87.45% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.69% | 93.31% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.73% | 94.45% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 87.45% | 85.31% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.62% | 96.38% |
| CHEMBL1871 | P10275 | Androgen Receptor | 86.21% | 96.43% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.18% | 93.18% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.18% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.96% | 96.09% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.73% | 92.98% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.63% | 96.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.20% | 96.47% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 80.47% | 89.63% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 134815171 |
| LOTUS | LTS0137590 |
| wikiData | Q75067701 |