Destruxin A, 1-(trans-3-methyl-L-proline)-
| Internal ID | 3168744f-dcb7-42aa-a702-79b4acf65f3e |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S,3S)-N-[(2S,3S)-1-[[(5R)-5-formyl-7-hydroxy-4,4-dimethyl-1-[[(2S)-2-(methylamino)propanoyl]amino]-3,6-dioxodec-9-en-5-yl]-methylamino]-3-methyl-1-oxopent-4-en-2-yl]-3-methylpyrrolidine-2-carboxamide |
| SMILES (Canonical) | CC1CCNC1C(=O)NC(C(C)C=C)C(=O)N(C)C(C=O)(C(=O)C(CC=C)O)C(C)(C)C(=O)CCNC(=O)C(C)NC |
| SMILES (Isomeric) | C[C@H]1CCN[C@@H]1C(=O)N[C@@H]([C@@H](C)C=C)C(=O)N(C)[C@](C=O)(C(=O)C(CC=C)O)C(C)(C)C(=O)CCNC(=O)[C@H](C)NC |
| InChI | InChI=1S/C30H49N5O7/c1-10-12-21(37)25(39)30(17-36,29(6,7)22(38)14-16-33-26(40)20(5)31-8)35(9)28(42)24(18(3)11-2)34-27(41)23-19(4)13-15-32-23/h10-11,17-21,23-24,31-32,37H,1-2,12-16H2,3-9H3,(H,33,40)(H,34,41)/t18-,19-,20-,21?,23-,24-,30+/m0/s1 |
| InChI Key | KECQQADFMBQUDM-IXJIIPDYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H49N5O7 |
| Molecular Weight | 591.70 g/mol |
| Exact Mass | 591.36319892 g/mol |
| Topological Polar Surface Area (TPSA) | 174.00 Ų |
| XlogP | 0.70 |
| Atomic LogP (AlogP) | -0.10 |
| H-Bond Acceptor | 9 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 18 |
| RefChem:1083204 |
| (2S,3S)-N-((2S,3S)-1-(((5R)-5-formyl-7-hydroxy-4,4-dimethyl-1-(((2S)-2-(methylamino)propanoyl)amino)-3,6-dioxodec-9-en-5-yl)-methylamino)-3-methyl-1-oxopent-4-en-2-yl)-3-methylpyrrolidine-2-carboxamide |
| BRN 1066502 |
| DTXSID30970803 |
| (2S,3S)-N-[(2S,3S)-1-{[(5R)-5-Formyl-7-hydroxy-1-{[(2S)-1-hydroxy-2-(methylamino)propylidene]amino}-4,4-dimethyl-3,6-dioxodec-9-en-5-yl](methyl)amino}-3-methyl-1-oxopent-4-en-2-yl]-3-methylpyrrolidine-2-carboximidic acid |
| N-{1-[(5-Formyl-7-hydroxy-1-{[1-hydroxy-2-(methylamino)propylidene]amino}-4,4-dimethyl-3,6-dioxodec-9-en-5-yl)(methyl)amino]-3-methyl-1-oxopent-4-en-2-yl}-3-methylpyrrolidine-2-carboximidic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5139 | 51.39% |
| Caco-2 | - | 0.8511 | 85.11% |
| Blood Brain Barrier | - | 0.6000 | 60.00% |
| Human oral bioavailability | - | 0.5571 | 55.71% |
| Subcellular localzation | Mitochondria | 0.5513 | 55.13% |
| OATP2B1 inhibitior | - | 0.7139 | 71.39% |
| OATP1B1 inhibitior | + | 0.8479 | 84.79% |
| OATP1B3 inhibitior | + | 0.9273 | 92.73% |
| MATE1 inhibitior | - | 0.9054 | 90.54% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.5998 | 59.98% |
| P-glycoprotein inhibitior | + | 0.6893 | 68.93% |
| P-glycoprotein substrate | + | 0.8033 | 80.33% |
| CYP3A4 substrate | + | 0.7088 | 70.88% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7929 | 79.29% |
| CYP3A4 inhibition | - | 0.7232 | 72.32% |
| CYP2C9 inhibition | - | 0.8770 | 87.70% |
| CYP2C19 inhibition | - | 0.8187 | 81.87% |
| CYP2D6 inhibition | - | 0.9131 | 91.31% |
| CYP1A2 inhibition | - | 0.9070 | 90.70% |
| CYP2C8 inhibition | + | 0.5644 | 56.44% |
| CYP inhibitory promiscuity | - | 0.9777 | 97.77% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8600 | 86.00% |
| Carcinogenicity (trinary) | Non-required | 0.5938 | 59.38% |
| Eye corrosion | - | 0.9827 | 98.27% |
| Eye irritation | - | 0.9283 | 92.83% |
| Skin irritation | - | 0.7637 | 76.37% |
| Skin corrosion | - | 0.8935 | 89.35% |
| Ames mutagenesis | - | 0.6800 | 68.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4798 | 47.98% |
| Micronuclear | + | 0.6800 | 68.00% |
| Hepatotoxicity | - | 0.5757 | 57.57% |
| skin sensitisation | - | 0.8473 | 84.73% |
| Respiratory toxicity | + | 0.5444 | 54.44% |
| Reproductive toxicity | + | 0.6778 | 67.78% |
| Mitochondrial toxicity | + | 0.8125 | 81.25% |
| Nephrotoxicity | - | 0.8850 | 88.50% |
| Acute Oral Toxicity (c) | III | 0.6338 | 63.38% |
| Estrogen receptor binding | + | 0.6502 | 65.02% |
| Androgen receptor binding | + | 0.6873 | 68.73% |
| Thyroid receptor binding | + | 0.6465 | 64.65% |
| Glucocorticoid receptor binding | + | 0.7054 | 70.54% |
| Aromatase binding | + | 0.6930 | 69.30% |
| PPAR gamma | + | 0.6858 | 68.58% |
| Honey bee toxicity | - | 0.7051 | 70.51% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5300 | 53.00% |
| Fish aquatic toxicity | - | 0.7096 | 70.96% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.67% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.45% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.89% | 96.09% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 96.68% | 95.71% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 96.32% | 96.47% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 94.71% | 89.34% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 94.31% | 92.12% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.80% | 93.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.62% | 97.14% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 92.34% | 98.57% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.27% | 100.00% |
| CHEMBL228 | P31645 | Serotonin transporter | 92.27% | 95.51% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 92.22% | 98.05% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.02% | 99.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.33% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.02% | 91.19% |
| CHEMBL222 | P23975 | Norepinephrine transporter | 90.40% | 96.06% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.37% | 90.08% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 89.50% | 95.00% |
| CHEMBL5028 | O14672 | ADAM10 | 89.47% | 97.50% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 88.99% | 97.50% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.92% | 97.79% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 88.48% | 98.75% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.41% | 92.88% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 88.28% | 97.47% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.25% | 96.61% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 88.13% | 98.33% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 88.04% | 81.29% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.60% | 96.21% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 87.32% | 98.59% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 87.26% | 94.66% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.50% | 91.03% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 86.21% | 98.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.73% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.22% | 91.11% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.15% | 93.03% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.07% | 94.00% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 83.44% | 96.31% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.22% | 100.00% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 83.19% | 85.31% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 82.89% | 90.93% |
| CHEMBL4246 | P42680 | Tyrosine-protein kinase TEC | 82.42% | 82.05% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 82.24% | 96.67% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.73% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.68% | 90.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.07% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 5748172 |
| LOTUS | LTS0014821 |
| wikiData | Q82954058 |