Desoxy-galiellalactone
| Internal ID | b8924734-06ec-4366-b763-9258661fb60b |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | (4R,7R,9S)-9-methyl-3-oxatricyclo[5.3.1.04,11]undec-1(10)-en-2-one |
| SMILES (Canonical) | CC1CC2CCC3C2C(=C1)C(=O)O3 |
| SMILES (Isomeric) | C[C@H]1C[C@H]2CC[C@@H]3C2C(=C1)C(=O)O3 |
| InChI | InChI=1S/C11H14O2/c1-6-4-7-2-3-9-10(7)8(5-6)11(12)13-9/h5-7,9-10H,2-4H2,1H3/t6-,7+,9+,10?/m0/s1 |
| InChI Key | BTDFZQUXKISOCL-FXXWNNQFSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.099379685 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 2.20 |
| (4R,7R,9S)-9-methyl-3-oxatricyclo[5.3.1.04,11]undec-1(10)-en-2-one |
| (4R,7R,9S)-9-methyl-3-oxatricyclo(5.3.1.04,11)undec-1(10)-en-2-one |
| RefChem:132285 |
| CHEBI:226255 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.73% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.42% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.84% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.53% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.75% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.44% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.91% | 86.33% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.78% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139586666 |
| LOTUS | LTS0083214 |
| wikiData | Q77511691 |