[3,4-Dihydroxy-5-[[3,4,5-trihydroxy-6-[(8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromen-6-yl)oxy]oxan-2-yl]methoxy]oxolan-3-yl]methyl 3,4,5-trimethoxybenzoate
| Internal ID | bbc5bda4-b050-4db5-a286-a10dec0c2d38 |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
| IUPAC Name | [3,4-dihydroxy-5-[[3,4,5-trihydroxy-6-[(8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromen-6-yl)oxy]oxan-2-yl]methoxy]oxolan-3-yl]methyl 3,4,5-trimethoxybenzoate |
| SMILES (Canonical) | CC1CC2=C(C(=CC(=C2)OC3C(C(C(C(O3)COC4C(C(CO4)(COC(=O)C5=CC(=C(C(=C5)OC)OC)OC)O)O)O)O)O)O)C(=O)O1 |
| SMILES (Isomeric) | CC1CC2=C(C(=CC(=C2)OC3C(C(C(C(O3)COC4C(C(CO4)(COC(=O)C5=CC(=C(C(=C5)OC)OC)OC)O)O)O)O)O)O)C(=O)O1 |
| InChI | InChI=1S/C31H38O17/c1-13-5-14-6-16(9-17(32)21(14)28(38)46-13)47-29-24(35)23(34)22(33)20(48-29)10-43-30-26(36)31(39,12-45-30)11-44-27(37)15-7-18(40-2)25(42-4)19(8-15)41-3/h6-9,13,20,22-24,26,29-30,32-36,39H,5,10-12H2,1-4H3 |
| InChI Key | XNBPCDMESPZVBF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H38O17 |
| Molecular Weight | 682.60 g/mol |
| Exact Mass | 682.21089974 g/mol |
| Topological Polar Surface Area (TPSA) | 239.00 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.69% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.00% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.47% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.60% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.05% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.70% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.67% | 95.56% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 90.75% | 92.98% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.71% | 91.07% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.51% | 98.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.12% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.93% | 99.17% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.11% | 92.94% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.05% | 97.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.98% | 94.45% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.27% | 97.53% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.16% | 94.73% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 83.15% | 85.31% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.82% | 96.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.80% | 90.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.63% | 92.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.61% | 95.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.55% | 98.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.36% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.96% | 85.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.45% | 96.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.35% | 95.89% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 80.05% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162921095 |
| LOTUS | LTS0056551 |
| wikiData | Q105331554 |