Daryamide E
| Internal ID | e8d63f77-95d4-488d-877d-8f1dbfe73c67 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Tertiary alcohols |
| IUPAC Name | (2E,4E)-N-[(1S,2R,5R,6S)-5-(3-amino-3-oxopropyl)-2,5-dihydroxy-7-oxabicyclo[4.1.0]hept-3-en-3-yl]-6-methylhepta-2,4-dienamide |
| SMILES (Canonical) | CC(C)C=CC=CC(=O)NC1=CC(C2C(C1O)O2)(CCC(=O)N)O |
| SMILES (Isomeric) | CC(C)/C=C/C=C/C(=O)NC1=C[C@@]([C@@H]2[C@H]([C@@H]1O)O2)(CCC(=O)N)O |
| InChI | InChI=1S/C17H24N2O5/c1-10(2)5-3-4-6-13(21)19-11-9-17(23,8-7-12(18)20)16-15(24-16)14(11)22/h3-6,9-10,14-16,22-23H,7-8H2,1-2H3,(H2,18,20)(H,19,21)/b5-3+,6-4+/t14-,15+,16+,17-/m1/s1 |
| InChI Key | WNZGVFZSAFOJKG-MVXXACGBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16852187 g/mol |
| Topological Polar Surface Area (TPSA) | 125.00 Ų |
| XlogP | -0.90 |
| (2E,4E)-N-[(1S,2R,5R,6S)-5-(3-amino-3-oxopropyl)-2,5-dihydroxy-7-oxabicyclo[4.1.0]hept-3-en-3-yl]-6-methylhepta-2,4-dienamide |
| (2E,4E)-N-((1S,2R,5R,6S)-5-(3-amino-3-oxopropyl)-2,5-dihydroxy-7-oxabicyclo(4.1.0)hept-3-en-3-yl)-6-methylhepta-2,4-dienamide |
| RefChem:130978 |
| CHEBI:207085 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.01% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.80% | 94.45% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 92.76% | 83.10% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.46% | 90.17% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 90.06% | 89.34% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.37% | 96.00% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 87.59% | 80.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 87.46% | 85.30% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.90% | 94.73% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.84% | 91.07% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.21% | 95.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.13% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.92% | 99.17% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 82.58% | 98.03% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.96% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 132967480 |
| LOTUS | LTS0083684 |
| wikiData | Q105309378 |