Damirone B
| Internal ID | 2960fbdc-3817-4f90-9d21-362115a5fb50 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Pyrroloquinolines > Pyrrolo[4,3,2-de]quinolines |
| IUPAC Name | 7-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8-triene-10,11-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H10N2O2/c1-13-3-2-6-5-12-10-9(6)7(13)4-8(14)11(10)15/h4-5,12H,2-3H2,1H3 |
| InChI Key | JYLGJUYDUWMFOL-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.074227566 g/mol |
| Topological Polar Surface Area (TPSA) | 53.20 Ų |
| XlogP | 0.50 |
| 138683-67-7 |
| 5-Methyl-4,5-dihydropyrrolo[4,3,2-de]quinoline-7,8(1H,3H)-dione |
| Pyrrolo[4,3,2-de]quinoline-7,8-dione, 1,3,4,5-tetrahydro-5-methyl- (9CI) |
| 7-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8-triene-10,11-dione |
| CHEMBL462951 |
| SCHEMBL9263961 |
| JYLGJUYDUWMFOL-UHFFFAOYSA- |
| DTXSID40930190 |
| 5-methyl-1,3,4,5-tetrahydropyrrolo[4,3,2-de]quinoline-7,8-dione |
| NSC700004 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.56% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.80% | 93.40% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.17% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.64% | 95.56% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.79% | 98.59% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 88.17% | 96.67% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.00% | 93.03% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.28% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.07% | 90.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.29% | 93.04% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.94% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.61% | 94.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 81.42% | 95.62% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.99% | 94.78% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.07% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 2947 |
| LOTUS | LTS0128933 |
| wikiData | Q82905432 |