2-[[6-[2-(4-Hydroxyphenyl)ethyl]-7-methyl-3-(2-methylsulfanylethyl)-2,5,8,11,14-pentaoxo-9-(2-phenylethyl)-12-propan-2-yl-1,4,7,10,13-pentazacyclononadec-15-yl]carbamoylamino]-3-phenylpropanoic acid
| Internal ID | e40c42a1-8ce1-4a5e-a611-7bf8f03b9346 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 2-[[6-[2-(4-hydroxyphenyl)ethyl]-7-methyl-3-(2-methylsulfanylethyl)-2,5,8,11,14-pentaoxo-9-(2-phenylethyl)-12-propan-2-yl-1,4,7,10,13-pentazacyclononadec-15-yl]carbamoylamino]-3-phenylpropanoic acid |
| SMILES (Canonical) | CC(C)C1C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NCCCCC(C(=O)N1)NC(=O)NC(CC2=CC=CC=C2)C(=O)O)CCSC)CCC3=CC=C(C=C3)O)C)CCC4=CC=CC=C4 |
| SMILES (Isomeric) | CC(C)C1C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NCCCCC(C(=O)N1)NC(=O)NC(CC2=CC=CC=C2)C(=O)O)CCSC)CCC3=CC=C(C=C3)O)C)CCC4=CC=CC=C4 |
| InChI | InChI=1S/C47H63N7O9S/c1-30(2)40-44(59)50-37(24-20-31-13-7-5-8-14-31)45(60)54(3)39(25-21-32-18-22-34(55)23-19-32)43(58)49-36(26-28-64-4)41(56)48-27-12-11-17-35(42(57)53-40)51-47(63)52-38(46(61)62)29-33-15-9-6-10-16-33/h5-10,13-16,18-19,22-23,30,35-40,55H,11-12,17,20-21,24-29H2,1-4H3,(H,48,56)(H,49,58)(H,50,59)(H,53,57)(H,61,62)(H2,51,52,63) |
| InChI Key | JJPVZVOERCOVBN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C47H63N7O9S |
| Molecular Weight | 902.10 g/mol |
| Exact Mass | 901.44079779 g/mol |
| Topological Polar Surface Area (TPSA) | 261.00 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.95% | 98.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 98.59% | 95.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.03% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 97.16% | 90.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.75% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.69% | 93.56% |
| CHEMBL268 | P43235 | Cathepsin K | 92.01% | 96.85% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 91.76% | 97.64% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.25% | 85.14% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.07% | 93.00% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 90.92% | 94.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.82% | 97.09% |
| CHEMBL4072 | P07858 | Cathepsin B | 90.25% | 93.67% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.57% | 90.71% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.16% | 94.62% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 88.49% | 95.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.35% | 97.14% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 88.11% | 92.67% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.54% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.70% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.52% | 90.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.34% | 95.50% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.13% | 98.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.93% | 99.17% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 84.87% | 88.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.46% | 99.15% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 81.97% | 98.24% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.87% | 95.38% |
| CHEMBL236 | P41143 | Delta opioid receptor | 80.71% | 99.35% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.26% | 95.89% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.11% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 76512075 |
| LOTUS | LTS0221234 |
| wikiData | Q104169610 |