(6S)-3-methylidene-6-(2-methylpropyl)piperazine-2,5-dione
| Internal ID | e7d60214-22b9-4edf-a70d-fa3cef2cb127 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | (6S)-3-methylidene-6-(2-methylpropyl)piperazine-2,5-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C9H14N2O2/c1-5(2)4-7-9(13)10-6(3)8(12)11-7/h5,7H,3-4H2,1-2H3,(H,10,13)(H,11,12)/t7-/m0/s1 |
| InChI Key | BTRFIVPVBRRXKJ-ZETCQYMHSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.105527694 g/mol |
| Topological Polar Surface Area (TPSA) | 58.20 Ų |
| XlogP | 1.00 |
| CTK1J6472 |
| 65530-38-3 |
| DTXSID60438860 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.67% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.88% | 97.25% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.24% | 94.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.68% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.60% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.16% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 88.17% | 90.08% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.59% | 83.82% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.47% | 92.88% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.10% | 96.47% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.12% | 95.56% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.07% | 88.56% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.07% | 98.03% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.25% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10375075 |
| LOTUS | LTS0185581 |
| wikiData | Q77515712 |