CID 22525311
| Internal ID | c3629075-dfc4-4224-9a9e-28d1a17bf72c |
| Taxonomy | Phenylpropanoids and polyketides > Macrolactams |
| IUPAC Name | N-(3,35-dichloro-12-oxo-10-propan-2-yl-8,37,40-trioxa-4,11,22,34,39-pentazadecacyclo[27.6.1.12,5.16,9.115,19.118,21.07,20.020,24.023,28.033,36]tetraconta-1(35),2,4,6,9(39),15(38),16,18,23(28),24,26,29(36),30,32-tetradecaen-13-yl)-2-hydroxy-3-methylbutanamide |
| SMILES (Canonical) | CC(C)C1C2=NC3=C(O2)C45C(NC6=C(C=CC=C64)C7=C8C(=CC=C7)NC(=C8C9=C(N=C3O9)Cl)Cl)OC2=C5C=C(CC(C(=O)N1)NC(=O)C(C(C)C)O)C=C2 |
| SMILES (Isomeric) | CC(C)C1C2=NC3=C(O2)C45C(NC6=C(C=CC=C64)C7=C8C(=CC=C7)NC(=C8C9=C(N=C3O9)Cl)Cl)OC2=C5C=C(CC(C(=O)N1)NC(=O)C(C(C)C)O)C=C2 |
| InChI | InChI=1S/C40H34Cl2N6O6/c1-15(2)27-37-46-29-32(54-37)40-20-9-5-8-19(18-7-6-10-22-25(18)26(33(41)43-22)31-34(42)48-38(29)53-31)28(20)47-39(40)52-24-12-11-17(13-21(24)40)14-23(35(50)45-27)44-36(51)30(49)16(3)4/h5-13,15-16,23,27,30,39,43,47,49H,14H2,1-4H3,(H,44,51)(H,45,50) |
| InChI Key | YKBUODYYSZSEIY-UHFFFAOYSA-N |
| Popularity | 34 references in papers |
| Molecular Formula | C40H34Cl2N6O6 |
| Molecular Weight | 765.60 g/mol |
| Exact Mass | 764.1916882 g/mol |
| Topological Polar Surface Area (TPSA) | 168.00 Ų |
| XlogP | 7.60 |
| Atomic LogP (AlogP) | 7.11 |
| H-Bond Acceptor | 9 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 4 |
| (2S)-N-[(10S,13S,21S)-3,35-Dichloro-12-oxo-10-propan-2-yl-8,37,40-trioxa-4,11,22,34,39-pentazadecacyclo[27.6.1.12,5.16,9.115,19.118,21.07,20.020,24.023,28.033,36]tetraconta-1(35),2,4,6,9(39),15(38),16,18,23(28),24,26,29(36),30,32-tetradecaen-13-yl]-2-hydroxy-3-methylbutanamide |
| N-(3,35-Dichloro-12-oxo-10-propan-2-yl-8,37,40-trioxa-4,11,22,34,39-pentazadecacyclo[27.6.1.12,5.16,9.115,19.118,21.07,20.020,24.023,28.033,36]tetraconta-1(35),2,4,6,9(39),15(38),16,18,23(28),24,26,29(36),30,32-tetradecaen-13-yl)-2-hydroxy-3-methylbutanamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9806 | 98.06% |
| Caco-2 | - | 0.8644 | 86.44% |
| Blood Brain Barrier | - | 0.7000 | 70.00% |
| Human oral bioavailability | - | 0.5857 | 58.57% |
| Subcellular localzation | Mitochondria | 0.4952 | 49.52% |
| OATP2B1 inhibitior | + | 0.8564 | 85.64% |
| OATP1B1 inhibitior | + | 0.8330 | 83.30% |
| OATP1B3 inhibitior | + | 0.9313 | 93.13% |
| MATE1 inhibitior | - | 0.7432 | 74.32% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.9944 | 99.44% |
| P-glycoprotein inhibitior | + | 0.7590 | 75.90% |
| P-glycoprotein substrate | + | 0.8282 | 82.82% |
| CYP3A4 substrate | + | 0.7259 | 72.59% |
| CYP2C9 substrate | - | 0.5936 | 59.36% |
| CYP2D6 substrate | - | 0.8361 | 83.61% |
| CYP3A4 inhibition | - | 0.9314 | 93.14% |
| CYP2C9 inhibition | - | 0.7092 | 70.92% |
| CYP2C19 inhibition | - | 0.6892 | 68.92% |
| CYP2D6 inhibition | - | 0.8434 | 84.34% |
| CYP1A2 inhibition | - | 0.7769 | 77.69% |
| CYP2C8 inhibition | + | 0.8435 | 84.35% |
| CYP inhibitory promiscuity | + | 0.6373 | 63.73% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7300 | 73.00% |
| Carcinogenicity (trinary) | Non-required | 0.4376 | 43.76% |
| Eye corrosion | - | 0.9888 | 98.88% |
| Eye irritation | - | 0.9261 | 92.61% |
| Skin irritation | - | 0.7942 | 79.42% |
| Skin corrosion | - | 0.9400 | 94.00% |
| Ames mutagenesis | + | 0.5500 | 55.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.8384 | 83.84% |
| Micronuclear | + | 0.8600 | 86.00% |
| Hepatotoxicity | + | 0.5675 | 56.75% |
| skin sensitisation | - | 0.8621 | 86.21% |
| Respiratory toxicity | + | 0.8333 | 83.33% |
| Reproductive toxicity | + | 0.8778 | 87.78% |
| Mitochondrial toxicity | + | 0.7250 | 72.50% |
| Nephrotoxicity | + | 0.4673 | 46.73% |
| Acute Oral Toxicity (c) | III | 0.6390 | 63.90% |
| Estrogen receptor binding | + | 0.7965 | 79.65% |
| Androgen receptor binding | + | 0.8053 | 80.53% |
| Thyroid receptor binding | + | 0.6613 | 66.13% |
| Glucocorticoid receptor binding | + | 0.6941 | 69.41% |
| Aromatase binding | + | 0.6462 | 64.62% |
| PPAR gamma | + | 0.7555 | 75.55% |
| Honey bee toxicity | - | 0.7366 | 73.66% |
| Biodegradation | - | 0.9250 | 92.50% |
| Crustacea aquatic toxicity | - | 0.5153 | 51.53% |
| Fish aquatic toxicity | + | 0.9478 | 94.78% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.13% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.66% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.29% | 98.95% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 96.56% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.31% | 96.09% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 95.78% | 85.11% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.82% | 98.05% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 94.41% | 92.29% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 93.36% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.28% | 99.23% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.43% | 92.62% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 91.77% | 96.09% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.40% | 96.21% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.36% | 95.71% |
| CHEMBL3837 | P07711 | Cathepsin L | 90.58% | 96.61% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.32% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.93% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.66% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.53% | 94.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 89.06% | 98.75% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 88.85% | 88.56% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 88.39% | 88.42% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 88.10% | 96.39% |
| CHEMBL1801 | P00747 | Plasminogen | 88.08% | 92.44% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 87.67% | 96.67% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.51% | 98.75% |
| CHEMBL1293289 | P25440 | Bromodomain-containing protein 2 | 87.33% | 86.19% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.27% | 93.03% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.43% | 92.98% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 85.27% | 97.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.82% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.69% | 96.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.61% | 98.59% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.52% | 95.56% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 84.26% | 96.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.15% | 89.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.15% | 96.90% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.49% | 89.50% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 83.44% | 98.57% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.37% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.11% | 99.15% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.56% | 97.50% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 82.56% | 96.11% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 82.17% | 97.31% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.83% | 95.38% |
| CHEMBL5028 | O14672 | ADAM10 | 81.74% | 97.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.10% | 86.33% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.59% | 85.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.20% | 82.69% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.11% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 22525311 |
| LOTUS | LTS0023590 |
| wikiData | Q105349589 |