14-(5,6-Dimethylhept-3-en-2-yl)-5-hydroxy-2,15-dimethyl-18-oxatetracyclo[8.7.1.02,7.011,15]octadec-9-en-16-one
| Internal ID | ce448b79-7dc1-482b-a2a2-35c432b5991b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 14-(5,6-dimethylhept-3-en-2-yl)-5-hydroxy-2,15-dimethyl-18-oxatetracyclo[8.7.1.02,7.011,15]octadec-9-en-16-one |
| SMILES (Canonical) | CC(C)C(C)C=CC(C)C1CCC2C1(C(=O)CC3C4(CCC(CC4CC=C2O3)O)C)C |
| SMILES (Isomeric) | CC(C)C(C)C=CC(C)C1CCC2C1(C(=O)CC3C4(CCC(CC4CC=C2O3)O)C)C |
| InChI | InChI=1S/C28H44O3/c1-17(2)18(3)7-8-19(4)22-10-11-23-24-12-9-20-15-21(29)13-14-27(20,5)26(31-24)16-25(30)28(22,23)6/h7-8,12,17-23,26,29H,9-11,13-16H2,1-6H3 |
| InChI Key | XFCWPFNQLVJSCP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.32904526 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 6.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.88% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.98% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.77% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.72% | 97.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.49% | 82.69% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 89.92% | 85.31% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.84% | 94.75% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.56% | 93.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.48% | 99.23% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 88.63% | 88.81% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.11% | 85.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.75% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.64% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.47% | 95.89% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.22% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.41% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.36% | 93.03% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.95% | 98.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.79% | 92.62% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.11% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85162568 |
| LOTUS | LTS0124343 |
| wikiData | Q104200919 |