(2R)-2-[(3R,6R,9Z,12R,15R,18S,21R,24S,27R)-21,24-bis(2-aminoethyl)-15-(3-aminopropyl)-3-[(1S)-2-chloro-1-hydroxyethyl]-27-[[(3R,4S)-3,4-dihydroxytetradecanoyl]amino]-9-ethylidene-12-[(1S)-1-hydroxyethyl]-18-(2-hydroxyethyl)-2,5,8,11,14,17,20,23,26-nonaoxo-1-oxa-4,7,10,13,16,19,22,25-octazacyclooctacos-6-yl]-2-hydroxyacetic acid
| Internal ID | fe0cb833-5023-4eac-bbeb-3576490cfe6a |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2R)-2-[(3R,6R,9Z,12R,15R,18S,21R,24S,27R)-21,24-bis(2-aminoethyl)-15-(3-aminopropyl)-3-[(1S)-2-chloro-1-hydroxyethyl]-27-[[(3R,4S)-3,4-dihydroxytetradecanoyl]amino]-9-ethylidene-12-[(1S)-1-hydroxyethyl]-18-(2-hydroxyethyl)-2,5,8,11,14,17,20,23,26-nonaoxo-1-oxa-4,7,10,13,16,19,22,25-octazacyclooctacos-6-yl]-2-hydroxyacetic acid |
| SMILES (Canonical) | CCCCCCCCCCC(C(CC(=O)NC1COC(=O)C(NC(=O)C(NC(=O)C(=CC)NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CCN)CCN)CCO)CCCN)C(C)O)C(C(=O)O)O)C(CCl)O)O)O |
| SMILES (Isomeric) | CCCCCCCCCC[C@@H]([C@@H](CC(=O)N[C@@H]1COC(=O)[C@H](NC(=O)[C@H](NC(=O)/C(=C/C)/NC(=O)[C@H](NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC1=O)CCN)CCN)CCO)CCCN)[C@H](C)O)[C@H](C(=O)O)O)[C@@H](CCl)O)O)O |
| InChI | InChI=1S/C50H87ClN12O19/c1-4-6-7-8-9-10-11-12-15-33(66)34(67)23-36(69)55-32-25-82-50(81)38(35(68)24-51)62-48(78)39(40(70)49(79)80)63-41(71)27(5-2)56-47(77)37(26(3)65)61-45(75)28(14-13-19-52)57-44(74)31(18-22-64)60-43(73)29(16-20-53)58-42(72)30(17-21-54)59-46(32)76/h5,26,28-35,37-40,64-68,70H,4,6-25,52-54H2,1-3H3,(H,55,69)(H,56,77)(H,57,74)(H,58,72)(H,59,76)(H,60,73)(H,61,75)(H,62,78)(H,63,71)(H,79,80)/b27-5-/t26-,28+,29+,30-,31-,32+,33-,34+,35+,37+,38+,39+,40+/m0/s1 |
| InChI Key | FXAAMFXCTWRSIJ-MIYGPKQWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C50H87ClN12O19 |
| Molecular Weight | 1195.70 g/mol |
| Exact Mass | 1194.5898963 g/mol |
| Topological Polar Surface Area (TPSA) | 525.00 Ų |
| XlogP | -4.20 |
| Atomic LogP (AlogP) | -6.67 |
| H-Bond Acceptor | 21 |
| H-Bond Donor | 19 |
| Rotatable Bonds | 27 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5774 | 57.74% |
| Caco-2 | - | 0.8593 | 85.93% |
| Blood Brain Barrier | - | 0.8250 | 82.50% |
| Human oral bioavailability | - | 0.6857 | 68.57% |
| Subcellular localzation | Mitochondria | 0.4866 | 48.66% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8256 | 82.56% |
| OATP1B3 inhibitior | + | 0.9185 | 91.85% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.9076 | 90.76% |
| P-glycoprotein inhibitior | + | 0.7411 | 74.11% |
| P-glycoprotein substrate | + | 0.8454 | 84.54% |
| CYP3A4 substrate | + | 0.7169 | 71.69% |
| CYP2C9 substrate | - | 0.8012 | 80.12% |
| CYP2D6 substrate | - | 0.8536 | 85.36% |
| CYP3A4 inhibition | - | 0.7329 | 73.29% |
| CYP2C9 inhibition | - | 0.8833 | 88.33% |
| CYP2C19 inhibition | - | 0.8609 | 86.09% |
| CYP2D6 inhibition | - | 0.9080 | 90.80% |
| CYP1A2 inhibition | - | 0.8636 | 86.36% |
| CYP2C8 inhibition | + | 0.6706 | 67.06% |
| CYP inhibitory promiscuity | - | 0.9805 | 98.05% |
| UGT catelyzed | - | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.7500 | 75.00% |
| Carcinogenicity (trinary) | Non-required | 0.5061 | 50.61% |
| Eye corrosion | - | 0.9825 | 98.25% |
| Eye irritation | - | 0.8965 | 89.65% |
| Skin irritation | - | 0.7526 | 75.26% |
| Skin corrosion | - | 0.9216 | 92.16% |
| Ames mutagenesis | - | 0.6500 | 65.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6716 | 67.16% |
| Micronuclear | + | 0.7800 | 78.00% |
| Hepatotoxicity | - | 0.5603 | 56.03% |
| skin sensitisation | - | 0.8413 | 84.13% |
| Respiratory toxicity | + | 0.7000 | 70.00% |
| Reproductive toxicity | + | 0.8222 | 82.22% |
| Mitochondrial toxicity | + | 0.8250 | 82.50% |
| Nephrotoxicity | + | 0.8743 | 87.43% |
| Acute Oral Toxicity (c) | III | 0.6593 | 65.93% |
| Estrogen receptor binding | + | 0.7206 | 72.06% |
| Androgen receptor binding | + | 0.7107 | 71.07% |
| Thyroid receptor binding | + | 0.5174 | 51.74% |
| Glucocorticoid receptor binding | + | 0.6058 | 60.58% |
| Aromatase binding | + | 0.6676 | 66.76% |
| PPAR gamma | + | 0.7238 | 72.38% |
| Honey bee toxicity | - | 0.7793 | 77.93% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | + | 0.5008 | 50.08% |
| Fish aquatic toxicity | + | 0.6775 | 67.75% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.97% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.59% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.75% | 89.63% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.51% | 96.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 97.28% | 96.47% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.89% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.79% | 97.29% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 95.45% | 92.88% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.41% | 99.17% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 95.13% | 98.03% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.71% | 92.86% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.65% | 97.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 94.50% | 95.50% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 94.35% | 95.00% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 94.09% | 96.11% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 93.69% | 89.34% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 93.46% | 95.71% |
| CHEMBL3837 | P07711 | Cathepsin L | 92.31% | 96.61% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 91.54% | 95.20% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 90.79% | 96.90% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 90.10% | 98.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.07% | 90.17% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 90.04% | 92.32% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.20% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.60% | 95.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 88.51% | 90.08% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.45% | 90.71% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 88.19% | 94.66% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.12% | 94.80% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.50% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.43% | 95.93% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 85.92% | 87.45% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 85.54% | 93.18% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.70% | 93.00% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 84.46% | 94.55% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 83.62% | 91.38% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.57% | 93.56% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.54% | 89.50% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.32% | 100.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.21% | 97.79% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.32% | 94.73% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 81.20% | 96.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.14% | 89.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.14% | 94.75% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 81.13% | 80.71% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.99% | 98.33% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 80.25% | 92.29% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.22% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162927002 |
| LOTUS | LTS0229053 |
| wikiData | Q105003773 |