[2-[2-[2-[[6-amino-2-[3-amino-1-[(2,3-diamino-3-oxopropyl)amino]-3-oxopropyl]-5-methylpyrimidine-4-carbonyl]amino]-3-[[5-[[1-[2-[4-[4-[3-[4-[(3-amino-3-oxopropyl)amino]butylamino]propylcarbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]ethylamino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-hydroxy-4-methyl-5-oxopentan-2-yl]amino]-1-(1H-imidazol-5-yl)-3-oxopropoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] carbamate
| Internal ID | f43f6262-5c43-437f-99d5-c7cb42dc87ac |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides > Hybrid glycopeptides |
| IUPAC Name | [2-[2-[2-[[6-amino-2-[3-amino-1-[(2,3-diamino-3-oxopropyl)amino]-3-oxopropyl]-5-methylpyrimidine-4-carbonyl]amino]-3-[[5-[[1-[2-[4-[4-[3-[4-[(3-amino-3-oxopropyl)amino]butylamino]propylcarbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]ethylamino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-hydroxy-4-methyl-5-oxopentan-2-yl]amino]-1-(1H-imidazol-5-yl)-3-oxopropoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] carbamate |
| SMILES (Canonical) | CC1=C(N=C(N=C1N)C(CC(=O)N)NCC(C(=O)N)N)C(=O)NC(C(C2=CN=CN2)OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)CO)O)OC(=O)N)O)C(=O)NC(C)C(C(C)C(=O)NC(C(C)O)C(=O)NCCC5=NC(=CS5)C6=NC(=CS6)C(=O)NCCCNCCCCNCCC(=O)N)O |
| SMILES (Isomeric) | CC1=C(N=C(N=C1N)C(CC(=O)N)NCC(C(=O)N)N)C(=O)NC(C(C2=CN=CN2)OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)CO)O)OC(=O)N)O)C(=O)NC(C)C(C(C)C(=O)NC(C(C)O)C(=O)NCCC5=NC(=CS5)C6=NC(=CS6)C(=O)NCCCNCCCCNCCC(=O)N)O |
| InChI | InChI=1S/C60H94N20O22S2/c1-24-38(77-51(80-49(24)64)29(16-36(63)85)72-17-28(61)50(65)91)55(95)79-40(46(30-18-69-23-73-30)100-59-48(44(89)42(87)33(19-81)99-59)101-58-45(90)47(102-60(66)97)43(88)34(20-82)98-58)56(96)74-26(3)41(86)25(2)52(92)78-39(27(4)83)54(94)71-15-9-37-75-32(22-103-37)57-76-31(21-104-57)53(93)70-13-7-12-67-10-5-6-11-68-14-8-35(62)84/h18,21-23,25-29,33-34,39-48,58-59,67-68,72,81-83,86-90H,5-17,19-20,61H2,1-4H3,(H2,62,84)(H2,63,85)(H2,65,91)(H2,66,97)(H,69,73)(H,70,93)(H,71,94)(H,74,96)(H,78,92)(H,79,95)(H2,64,77,80) |
| InChI Key | FLEOSJSDCPKPCJ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C60H94N20O22S2 |
| Molecular Weight | 1511.60 g/mol |
| Exact Mass | 1510.62929705 g/mol |
| Topological Polar Surface Area (TPSA) | 751.00 Ų |
| XlogP | -9.40 |
| Atomic LogP (AlogP) | -8.75 |
| H-Bond Acceptor | 34 |
| H-Bond Donor | 23 |
| Rotatable Bonds | 43 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7037 | 70.37% |
| Caco-2 | - | 0.8599 | 85.99% |
| Blood Brain Barrier | - | 0.7500 | 75.00% |
| Human oral bioavailability | - | 0.8429 | 84.29% |
| Subcellular localzation | Mitochondria | 0.4705 | 47.05% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8004 | 80.04% |
| OATP1B3 inhibitior | + | 0.9358 | 93.58% |
| MATE1 inhibitior | - | 0.9219 | 92.19% |
| OCT2 inhibitior | - | 0.8811 | 88.11% |
| BSEP inhibitior | + | 0.9519 | 95.19% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8650 | 86.50% |
| CYP3A4 substrate | + | 0.7556 | 75.56% |
| CYP2C9 substrate | - | 0.5927 | 59.27% |
| CYP2D6 substrate | - | 0.8483 | 84.83% |
| CYP3A4 inhibition | - | 0.5439 | 54.39% |
| CYP2C9 inhibition | - | 0.7575 | 75.75% |
| CYP2C19 inhibition | - | 0.7421 | 74.21% |
| CYP2D6 inhibition | - | 0.8816 | 88.16% |
| CYP1A2 inhibition | - | 0.7913 | 79.13% |
| CYP2C8 inhibition | + | 0.8567 | 85.67% |
| CYP inhibitory promiscuity | - | 0.8273 | 82.73% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.5639 | 56.39% |
| Eye corrosion | - | 0.9837 | 98.37% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7698 | 76.98% |
| Skin corrosion | - | 0.9261 | 92.61% |
| Ames mutagenesis | + | 0.9600 | 96.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7183 | 71.83% |
| Micronuclear | + | 0.7600 | 76.00% |
| Hepatotoxicity | - | 0.7250 | 72.50% |
| skin sensitisation | - | 0.8518 | 85.18% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9556 | 95.56% |
| Mitochondrial toxicity | + | 0.8750 | 87.50% |
| Nephrotoxicity | + | 0.6472 | 64.72% |
| Acute Oral Toxicity (c) | III | 0.5858 | 58.58% |
| Estrogen receptor binding | - | 0.5748 | 57.48% |
| Androgen receptor binding | + | 0.8547 | 85.47% |
| Thyroid receptor binding | + | 0.8264 | 82.64% |
| Glucocorticoid receptor binding | + | 0.8473 | 84.73% |
| Aromatase binding | + | 0.8537 | 85.37% |
| PPAR gamma | + | 0.7758 | 77.58% |
| Honey bee toxicity | - | 0.6112 | 61.12% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.6500 | 65.00% |
| Fish aquatic toxicity | + | 0.7585 | 75.85% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.67% | 96.09% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 99.36% | 96.21% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.68% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.23% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 97.79% | 94.73% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 97.64% | 98.05% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.40% | 83.82% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 97.37% | 95.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.04% | 94.45% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 95.89% | 97.53% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 95.54% | 97.36% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 95.47% | 96.28% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 95.38% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.16% | 90.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 94.04% | 92.29% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.81% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.75% | 99.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.99% | 97.25% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 92.80% | 96.90% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 92.29% | 93.03% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.38% | 93.56% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 90.72% | 88.42% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.98% | 95.56% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.69% | 95.17% |
| CHEMBL5028 | O14672 | ADAM10 | 89.39% | 97.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.51% | 100.00% |
| CHEMBL4071 | P08311 | Cathepsin G | 86.42% | 94.64% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.31% | 89.34% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.26% | 97.79% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 85.58% | 82.86% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 85.20% | 94.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 84.50% | 98.33% |
| CHEMBL3776 | Q14790 | Caspase-8 | 84.46% | 97.06% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 84.43% | 100.00% |
| CHEMBL4296013 | Q5VWK5 | Interleukin-23 receptor | 84.14% | 88.00% |
| CHEMBL1993 | P26358 | DNA (cytosine-5)-methyltransferase 1 | 83.44% | 95.44% |
| CHEMBL1881 | P43116 | Prostanoid EP2 receptor | 83.22% | 93.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.84% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.69% | 97.09% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.41% | 85.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.18% | 94.33% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 81.12% | 97.23% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 81.07% | 95.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.80% | 94.00% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 80.62% | 95.48% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.21% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 74405818 |
| LOTUS | LTS0144163 |
| wikiData | Q104997006 |