2,4b,7,7,10a,12a-Hexamethyl-1-[3-(4-methylphenyl)butyl]-1,2,4a,5,6,6a,8,9,10,10b,11,12-dodecahydrochrysene
| Internal ID | 2ee1f2ec-f48f-4099-928e-dd035a783ef7 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesterterpenoids > Scalarane sesterterpenoids |
| IUPAC Name | 2,4b,7,7,10a,12a-hexamethyl-1-[3-(4-methylphenyl)butyl]-1,2,4a,5,6,6a,8,9,10,10b,11,12-dodecahydrochrysene |
| SMILES (Canonical) | CC1C=CC2C3(CCC4C(CCCC4(C3CCC2(C1CCC(C)C5=CC=C(C=C5)C)C)C)(C)C)C |
| SMILES (Isomeric) | CC1C=CC2C3(CCC4C(CCCC4(C3CCC2(C1CCC(C)C5=CC=C(C=C5)C)C)C)(C)C)C |
| InChI | InChI=1S/C35H54/c1-24-10-14-27(15-11-24)25(2)12-16-28-26(3)13-17-30-33(28,6)22-19-31-34(7)21-9-20-32(4,5)29(34)18-23-35(30,31)8/h10-11,13-15,17,25-26,28-31H,9,12,16,18-23H2,1-8H3 |
| InChI Key | PFALEWMODCLBRK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H54 |
| Molecular Weight | 474.80 g/mol |
| Exact Mass | 474.422551722 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 12.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.60% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.54% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.49% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.21% | 93.99% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.91% | 94.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.73% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.35% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.87% | 97.09% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 88.75% | 95.92% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.54% | 97.79% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.21% | 83.82% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.79% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.07% | 90.71% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.33% | 90.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.87% | 93.56% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.86% | 93.18% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.06% | 94.62% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.39% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.33% | 94.45% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.51% | 89.62% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.29% | 90.08% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 80.73% | 92.97% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.31% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163018380 |
| LOTUS | LTS0132991 |
| wikiData | Q105207603 |